diff --git a/diff_nmrCV1.1-nmrCV_2025-03-20.html b/diff_nmrCV1.1-nmrCV_2025-03-20.html
new file mode 100644
index 0000000..92ab625
--- /dev/null
+++ b/diff_nmrCV1.1-nmrCV_2025-03-20.html
@@ -0,0 +1,15694 @@
+
+
+
+
+
+
+
+ OWL diff
+
+
+
+Ontology comparison
+Left
+
+- Ontology IRI: <http://nmrML.org/nmrCV>
+- Version IRI: <http://nmrml.org/cv/v1.1.0/nmrCV.owl>
+- Loaded from: <file:/work/nmrCV_v1.1.0.owl>
+
+Right
+
+- Ontology IRI: <http://nmrML.org/nmrCV.owl>
+- Version IRI: <http://nmrml.org/cv/2025-03-20/nmrCV.owl>
+- Loaded from: <file:/work/nmrCV.owl>
+
+
+
Ontology imports
+
+
+
+
+
+
+
Ontology annotations
+
+
+
+ - defaultLanguage "en"^^string
+- example of usage "http://nmrml.org/examples/"^^string
+- definition "This artefact is an MSI-approved controlled vocabulary primarily developed under COSMOS EU and PhenoMeNal EU governance. The nmrCV is supporting the nmrML XML format with standardized terms. nmrML is a vendor agnostic open access NMR raw data standard. Its primaly role is analogous to the mzCV for the PSI-approved mzML XML format. It uses BFO2.0 as its Top level.
+ This CV was derived from two predecessors (The NMR CV from the David Wishart Group, developed by Joseph Cruz) and the MSI nmr CV developed by Daniel Schober at the EBI. This simple taxonomy of terms (no DL semantics used) serves the nuclear magnetic resonance markup language (nmrML) with meaningful descriptors to amend the nmrML xml file with CV terms. Metabolomics scientists are encouraged to use this CV to annotrate their raw and experimental context data, i.e. within nmrML. The approach to have an exchange syntax mixed of an xsd and CV stems from the PSI mzML effort. The reason to branch out from an xsd into a CV is, that in areas where the terminology is likely to change faster than the nmrML xsd could be updated and aligned, an externally and decentrallised maintained CV can accompensate for such dynamics in a more flexible way. A second reason for this set-up is that semantic validity of CV terms used in an nmrML XML instance (allowed CV terms, position/relation to each other, cardinality) can be validated by rule-based proprietary validators: By means of cardinality specifications and XPath expressions defined in an XML mapping file (an instances of the CvMappingRules.xsd ), one can define what ontology terms are allowed in a specific location of the data model."^^string
+- curator note "In case we like to be able to convert this owl CV back into the obo format, we should only use DL/owl constructs that are supported by obo. Hence, editors of this CV should take care not to use any higher descriptrion logics semantics, i.e. cardinality restrictions or defined terms using constructors. We should start to build the taxonomic backbone first and later connect the main axis via relations.
+If we want to use restrictions, we should only use existential quantifiers as the OBO format does not support universal quantification.
+
+List of terms required by current XSD (August 2013): these were bookmarked in CV (annotation property) and are visible in the new nmrTab:
+
+CVTerm occurrences:
+buffer-->buffer
+solvent-->solvent
+concentration standard type-->calibration compound , what is chemical shift reference ? What calibration_reference_shift under calibration compound ?
+concentration standard name we here see a use-mention problem arising for the CV. The xsd should probably change here to avoid this.
+encoding method (Quadrature detection method) is this the same as encoding method ?
+sample container-->NMR_sample_holder
+(spectrum) y axis type-->coordinate system descriptor
+post acquisition solvent suppression method Two usages in xsd, but with differrent type ? -->solvent suppression method
+calibration compound Two usages in xsd, but with differrent type ?-->calibration compound
+data transformation method-->data transformation method
+(spectral) projection method-->projection method
+spectral denoising method-->spectral denoising method
+window function method-->window function method
+baseline correction method-->baseline correction
+sample type-->NMR sample
+
+CVParam occurrences:
+file content-->data file content
+software type-->software
+source file type-->data file attribute (needs refactoring)
+instrument configuration type-->instrument configuration
+processing method type-->data processing method
+
+CVParamType occurrences:
+chemical shift standard-->chemical shift standard
+solvent suppression method-->solvent suppression method
+encoding scheme (Quadrature detection method)-->encoding method
+window function parameter-->window function parameter
+
+CVParamWithUnitType occurrences:
+CVParamWithUnitType is currently not used in the xsd and dangling ! I assume ValueWithUnitType substitutes it ?
+
+UserParamType occurrences:
+No CV terms needed
+
+ValueWithUnitType occurrences:
+These will have to be used from the Unit ontology."^^string
+- contributor "Annick Moing"^^string
+- contributor "Catherine Deborde"^^string
+- contributor "Daniel Jacob"^^string
+- contributor "Daniel Schober"^^string
+- contributor "Philippe Rocca-Serra"^^string
+- contributor "Reza Salek"^^string
+- contributor "Since this is a prolonged effort spanning a larger time period, there naturally were many people involved in the creation over the years and during different times.
+
+People involved in the term creation from ID >1400000 :
+
+This part of the NMR ontology was originally developed by the ontology working group (http://msi-ontology.sourceforge.net/) of the msi-metabolomicssociety (msi-workgroups.sf.net):
+
+Daniel Schober (EBI)
+Chris Taylor (EBI and HUPO-PSI)
+Dennis Rubtsov (Un of Cambridge, UK)
+Helen Jenkins (Un of Wales, Aberystwyth, UK)
+Irena Spasic (Center for Integrative Systems Biology, Manchester, UK)
+Larissa Soldatova (University of Wales, Aberystwyth, UK)
+Philippe Rocca-Serra (EBI and MGED Society)
+Susanna-Assunta Sansone (EBI)
+
+People involved in the term creation from ID<1400000:
+
+Joseph Cruz
+Daniel Schober
+Michael Wilson
+Reza Salek
+Daniel Jacob
+David Wishart
+
+Terms with IDs ID<1400000 that were NOT asserted in the original Wishart obo file were created by Daniel Schober (COSMOS WP2). Its IDs were autogenerated with the Protege ID generator.
+
+Other people that substantially helped in revising the latest and Cosmos governed CV additions were:
+
+Michael Wilson, Wishart Group, Edmonton, Alberta, Canada
+Daniel Jacob, INRA, Bordeaux, France
+Annick Moing, INRA, Bordeaux, France
+Catherine Deborde, INRA, Bordeaux, France
+Reza Salek, EBI, Hinxton, UK
+Philippe Rocca-Serra, University of Oxford, Oxford, UK
+Andrea Porzel, IPB-Halle, Germany
+and the COSMOS WP2 team
+
+A paper describing the overall nmrML data standard and CV has been accepted by Analytical Chemistry (Manuscript ID: ac-2017-02795f.R1), title
+`nmrML: a community supported open data standard for the description, storage, and exchange of NMR data`, author(s): Schober, Daniel; Jacob, Daniel; Wilson, Michael; Cruz, Joseph; Marcu, Ana; Grant, Jason; Moing, Annick; Deborde, Catherine; de Figueiredo, Luis; Haug, Kenneth; Rocca-Serra, Philippe; Easton, John; Ebbels, Timothy; Hao, Jie; Ludwig, Christian; Günther, Ulrich; Rosato, Antonio; Klein, Matthias; Lewis, Ian; Luchinat, Claudio; Jones, Andrew; Grauslys, Arturas; Larralde, Martin; Yokochi, Masashi; Kobayashi, Naohiro; Porzel, Andrea; Griffin, Julian; Viant, Mark; Wishart, David; Steinbeck, Christoph; Salek, Reza; Neumann, Steffen"^^string
+- contributor "Steffen Neumann"^^string
+- coverage "Nuclear magnetic resonance (NMR) data annotation as required by the msi sanctioned open access nmrML XML format developed by the COSMOS EU project."^^string
+- format "OWL
+
+MIME type application/rdf+xml
+
+(Rather flat CV in OWL syntax. Taxonomic backbone with few relations used. No OWL DL complexity such as cardinalities, blank nodes, nested class definitions. The Semantic Validator used an OBO converted file format due to historic reasons. The OBO file is auto-generated-by the OWL API (version 3.4.2).)"^^string
+- rights "Creative Commons Public Domain Mark 1.0"
+- title "nuclear magnetic resonance CV"^^string
+- bug-database "https://github.com/nmrML/nmrML/issues"^^string
+- documenter "Daniel Schober"^^string
+- location "https://github.com/nmrML/nmrML/tree/master/ontologies"^^string
+- mailing-list "https://groups.google.com/forum/?hl=en#!forum/nmrml/join"^^string
+- maintainer "http://www.metabolomics-msi.org/
+http://phenomenal-h2020.eu/home/
+http://www.cosmos-fp7.eu/WP2"^^string
+- auto-generated-by "OBO-Edit 2.2"^^string
+- created_by "Daniel Schober"^^string
+- creation_date "2017-10-19T10:11:26Z"^^dateTime
+- has_obo_format_version "1.2"^^string
+- saved-by "dschober"^^string
+- homepage "http://nmrml.org/cv/"^^string
+- deprecated "http://www.metabolomicscentre.ca/nmrML/msi-nmr.obo"^^string
+- versionInfo "1.1.0"^^string
+- comment "This version (1.1.0) uses the Basic Formal Ontology (BFO) as its top level ontology. We might at some point close the resulting semantic gap by using OBI and IAO as intermediate bridges."^^string
+
+
+
+
+
+ - contributor "Chris Taylor"
+- contributor "Dennis Rubtsov"
+- contributor "Helen Jenkins"
+- contributor "Irena Spasic"
+- contributor "Larissa Soldatova"
+- coverage "Nuclear magnetic resonance (NMR) data annotation as required by the msi sanctioned open
+access nmrML XML format developed by the COSMOS EU project."
+- creator "COSMOS - COordination Of Standards In MetabOlomicS Project - WP2 team"
+- abstract "With this artifact, the Nuclear Magnetic Resonance Controlled Vocabulary (nmrCV) is undergoing a significant evolution to become an ontology designed to describe NMR spectroscopy experiments and their outputs in detail, supporting FAIR research data management. Initially, nmrCV v1.1.0 was deliberately designed as a controlled vocabulary, not a formal ontology with Description Logic (DL) semantics. It was approved by th Metabolomics Standards Initiative (MSI) and serves to provide descriptors for the nuclear magnetic resonance markup language (nmrML), enabling vendor-agnostic NMR data sharing, particularly within NMR metabolomics. Since version 1.1.0, nmrCV had not been updated nor actively maintained.
+
+Recognizing the need for a DL-enabled NMR spectroscopy ontology suitable for use independently of nmrML within a larger ontology framework, and addressing the limitations of the original controlled vocabulary, Germany's National Research Data Infrastructure project for Chemistry (NFDI4Chem) took on the responsibility for nmrCV's further development and maintenance. This decision was made after a discussion about its optimal integration within the broader ontology landscape at the third Ontologies4Chem workshop in fall 2023.
+
+The decision to build upon nmrCV v1.1.0 was based on its existing definition of essential concepts, its BFO alignment, and its planned integration with ontologies like the Ontology for Biomedical Investigations (OBI) and the Chemical Entities of Biological Interest (ChEBI). Improvements in the present version include replacing out-of-scope and placeholder terms with more suitable equivalents from established ontologies like OBI and ChEBI, adhering to the OBO Foundry principles, corrections regarding the BFO subsumption and other established ontology design patterns, as well as the introduction of DL semantics.
+
+⚠️ Compatibility Note: Due to these significant changes, which prioritize ontology rigor over nmrML alignment, this and future versions of nmrCV may introduce breaking changes for nmrML users. Therefore, nmrML users are strongly advised to thoroughly test new nmrCV versions before production deployment. Alternatively, users may choose to continue using nmrCV v1.1.0, which was specifically designed for nmrML compatibility."@en
+- contributor Susanna-Assunta Sansone
+- contributor Catherine Deborde
+- contributor Reza Salek
+- contributor Philip Strömert
+- contributor David S Wishart
+- contributor Daniel Jacob
+- contributor Steffen Neumann
+- contributor Andrea Porzel
+- contributor Annick Moing
+- contributor Noura Rayya
+- created "2025-03-20"
+- license <https://creativecommons.org/publicdomain/mark/1.0/>
+- references "https://doi.org/10.1021/acs.analchem.7b02795"
+- title "nuclear magnetic resonance CV"
+- preferredNamespacePrefix "nmrCV"
+- bug-database "https://github.com/nmrML/nmrCV/issues"
+- location "https://github.com/nmrML/nmrCV"
+- maintainer NFDI4Chem
+- priorVersion nmrCV.owl
+- versionInfo "2.0_alpha"
+- versionInfo "2025-03-20"
+
+
+
+
2,2-Dimethyl-2-silapentane-5-sulfonate - http://nmrML.org/nmrCV#NMR:1000429
+
+
+
+
+
+
+
+
+
+
(trifluoromethyl)benzene - http://purl.obolibrary.org/obo/CHEBI_36810
+
+
+
+
+
+
+
1,1,2,2-tetrachlorethane-d2 - http://purl.obolibrary.org/obo/CHEBI_193134
+
+
+
+
+ - 1,1,2,2-tetrachlorethane-d2 inchikey "QPFMBZIOSGYJDE-QDNHWIQGSA-N"
+- 1,1,2,2-tetrachlorethane-d2 has related synonym "TCE-d2"
+- 1,1,2,2-tetrachlorethane-d2 inSubset _STAR
+- 1,1,2,2-tetrachlorethane-d2 has_obo_namespace "chebi_ontology"
+- 1,1,2,2-tetrachlorethane-d2 charge "0"
+- 1,1,2,2-tetrachlorethane-d2 monoisotopicmass "167.90361"
+- 1,1,2,2-tetrachlorethane-d2 id "CHEBI:193134"
+- 1,1,2,2-tetrachlorethane-d2 smiles "ClC(Cl)(C(Cl)(Cl)[H])[H]"
+- 1,1,2,2-tetrachlorethane-d2 inchi "InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H/i1D,2D"
+- 1,1,2,2-tetrachlorethane-d2 label "1,1,2,2-tetrachlorethane-d2"
+- 1,1,2,2-tetrachlorethane-d2 formula "C2D2Cl4"
+- 1,1,2,2-tetrachlorethane-d2 database_cross_reference "CAS:33685-54-0"
+- 1,1,2,2-tetrachlorethane-d2 mass "169.850"
+- 1,1,2,2-tetrachlorethane-d2 has_exact_synonym "1,1,2,2-tetrachloro-1,2-dideuterioethane"
+- Class: 1,1,2,2-tetrachlorethane-d2
+- 1,1,2,2-tetrachlorethane-d2 SubClassOf deuterated compound
+- 1,1,2,2-tetrachlorethane-d2 SubClassOf NMR solvent
+- 1,1,2,2-tetrachlorethane-d2 SubClassOf polyatomic entity
+- 1,1,2,2-tetrachlorethane-d2 SubClassOf main group molecular entity
+
+
+
+
1,1,2-Trichlorotrifluoroethane - http://purl.obolibrary.org/obo/CHEBI_193131
+
+
+
+
+ - 1,1,2-Trichlorotrifluoroethane has related synonym "CFC-113"
+- 1,1,2-Trichlorotrifluoroethane database_cross_reference "Wikipedia:https://en.wikipedia.org/wiki/1,1,2-Trichloro-1,2,2-trifluoroethane"
+- 1,1,2-Trichlorotrifluoroethane label "1,1,2-Trichlorotrifluoroethane"
+- 1,1,2-Trichlorotrifluoroethane monoisotopicmass "185.90177"
+- 1,1,2-Trichlorotrifluoroethane has_obo_namespace "chebi_ontology"
+- 1,1,2-Trichlorotrifluoroethane inchi "InChI=1S/C2Cl3F3/c3-1(4,6)2(5,7)8"
+- 1,1,2-Trichlorotrifluoroethane inchikey "AJDIZQLSFPQPEY-UHFFFAOYSA-N"
+- 1,1,2-Trichlorotrifluoroethane formula "C2Cl3F3"
+- 1,1,2-Trichlorotrifluoroethane has related synonym "Freon 113"
+- 1,1,2-Trichlorotrifluoroethane mass "187.370"
+- 1,1,2-Trichlorotrifluoroethane database_cross_reference "CAS:76-13-1"
+- 1,1,2-Trichlorotrifluoroethane has_exact_synonym "1,1,2-trichloro-1,2,2-trifluoroethane"
+- 1,1,2-Trichlorotrifluoroethane inSubset _STAR
+- 1,1,2-Trichlorotrifluoroethane charge "0"
+- 1,1,2-Trichlorotrifluoroethane smiles "C(C(Cl)(F)F)(F)(Cl)Cl"
+- 1,1,2-Trichlorotrifluoroethane id "CHEBI:193131"
+- Class: 1,1,2-Trichlorotrifluoroethane
+- 1,1,2-Trichlorotrifluoroethane SubClassOf main group molecular entity
+- 1,1,2-Trichlorotrifluoroethane SubClassOf polyatomic entity
+- 1,1,2-Trichlorotrifluoroethane SubClassOf NMR solvent
+
+
+
+
1,4-Dioxane - http://nmrML.org/nmrCV#NMR:1000025
+
+
+
+
+
+
+
+
+
+
1,4-difluorobenzene - http://purl.obolibrary.org/obo/CHEBI_38585
+
+
+
+
+ - 1,4-difluorobenzene inchikey "QUGUFLJIAFISSW-UHFFFAOYSA-N"
+- 1,4-difluorobenzene inchi "InChI=1S/C6H4F2/c7-5-1-2-6(8)4-3-5/h1-4H"
+- 1,4-difluorobenzene database_cross_reference "CAS:540-36-3"
- source "NIST Chemistry WebBook"
+- 1,4-difluorobenzene has_exact_synonym "1,4-difluorobenzene"
+- 1,4-difluorobenzene smiles "Fc1ccc(F)cc1"
+- 1,4-difluorobenzene database_cross_reference "Gmelin:142070"
+- 1,4-difluorobenzene id "CHEBI:38585"
+- 1,4-difluorobenzene formula "C6H4F2"
+- 1,4-difluorobenzene database_cross_reference "CAS:540-36-3"
+- 1,4-difluorobenzene has related synonym "p-difluorobenzene"
+- 1,4-difluorobenzene mass "114.09277"
+- 1,4-difluorobenzene has related synonym "para-difluorobenzene"
+- 1,4-difluorobenzene monoisotopicmass "114.02811"
+- 1,4-difluorobenzene has related synonym "1,4-Difluorbenzol"
+- 1,4-difluorobenzene database_cross_reference "Beilstein:1904541"
+- 1,4-difluorobenzene charge "0"
+- 1,4-difluorobenzene label "1,4-difluorobenzene"
+- 1,4-difluorobenzene has_obo_namespace "chebi_ontology"
+- 1,4-difluorobenzene inSubset _STAR
+- Class: 1,4-difluorobenzene
+- 1,4-difluorobenzene SubClassOf polyatomic entity
+- 1,4-difluorobenzene SubClassOf main group molecular entity
+
+
+
+
1,4-dioxane - http://purl.obolibrary.org/obo/CHEBI_47032
+
+
+
+
+ - 1,4-dioxane database_cross_reference "CAS:123-91-1"
+- 1,4-dioxane has related synonym "tetrahydro-p-dioxin"
+- 1,4-dioxane formula "C4H8O2"
+- 1,4-dioxane label "1,4-dioxane"
+- 1,4-dioxane database_cross_reference "PMID:18044507"
+- 1,4-dioxane hasAlternativeId "CHEBI:46925"
+- 1,4-dioxane mass "88.10512"
+- 1,4-dioxane inSubset _STAR
+- 1,4-dioxane has related synonym "1,4-DIETHYLENE DIOXIDE"
+- 1,4-dioxane database_cross_reference "Reaxys:102551"
+- 1,4-dioxane database_cross_reference "PMID:14550759"
+- 1,4-dioxane database_cross_reference "LINCS:LSM-37087"
+- 1,4-dioxane has related synonym "di(ethylene oxide)"
+- 1,4-dioxane has related synonym "glycol ethylene ether"
+- 1,4-dioxane database_cross_reference "CAS:123-91-1"
- source "NIST Chemistry WebBook"
+- 1,4-dioxane smiles "C1COCCO1"
+- 1,4-dioxane has_exact_synonym "1,4-dioxane"
+- 1,4-dioxane database_cross_reference "Wikipedia:1,4-Dioxane"
+- 1,4-dioxane has related synonym "1,4-dioxacyclohexane"
+- 1,4-dioxane has_exact_synonym "1,4-Dioxane"
+- 1,4-dioxane inchi "InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2"
+- 1,4-dioxane definition "A dioxane with oxygen atoms at positions 1 and 4."
+- 1,4-dioxane charge "0"
+- 1,4-dioxane database_cross_reference "PDBeChem:DIO"
+- 1,4-dioxane id "CHEBI:47032"
+- 1,4-dioxane has related synonym "tetrahydro-para-dioxin"
+- 1,4-dioxane database_cross_reference "KEGG:C14440"
+- 1,4-dioxane database_cross_reference "DrugBank:DB03316"
+- 1,4-dioxane has related synonym "1,4-Dioxan"
+- 1,4-dioxane monoisotopicmass "88.05243"
+- 1,4-dioxane has related synonym "Dioxan-1,4"
+- 1,4-dioxane database_cross_reference "PMID:20598439"
+- 1,4-dioxane has_obo_namespace "chebi_ontology"
+- 1,4-dioxane hasAlternativeId "CHEBI:41951"
+- 1,4-dioxane has related synonym "dioxane-1,4"
+- 1,4-dioxane database_cross_reference "PPDB:1638"
+- 1,4-dioxane inchikey "RYHBNJHYFVUHQT-UHFFFAOYSA-N"
+- 1,4-dioxane database_cross_reference "CAS:123-91-1"
+- 1,4-dioxane hasAlternativeId "CHEBI:34064"
+- 1,4-dioxane has related synonym "p-Dioxane"
+- 1,4-dioxane has related synonym "tetrahydro-1,4-dioxin"
+- Class: 1,4-dioxane
+- 1,4-dioxane SubClassOf main group molecular entity
+- 1,4-dioxane SubClassOf polyatomic entity
+
+
+
+
1,4-morpholine - http://nmrML.org/nmrCV#NMR:1000039
+
+
+
+
+
+
+
+
+
+
1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) - http://purl.obolibrary.org/obo/CHEBI_195173
+
+
+
+
+ - 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) monoisotopicmass "218.04089"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) has_obo_namespace "chebi_ontology"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) has_exact_synonym "sodium;3-trimethylsilylpropane-1-sulonate"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) inchikey "HWEXKRHYVOGVDA-UHFFFAOYSA-M"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) inchi "InChI=1S/C6H16O3SSi.Na/c1-11(2,3)6-4-5-10(7,8)9;/h4-6H2,1-3H3,(H,7,8,9);/q;+1/p-1"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) inSubset _STAR
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) smiles "S([O-])(=O)(=O)CCC[Si](C)(C)C.[Na+]"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) charge "0"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) id "CHEBI:195173"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) formula "C6H15O3SSi.Na"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) mass "218.320"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) database_cross_reference "Chemspider:67436"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) database_cross_reference "KEGG:D84158"
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) label "1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt)"
+- Class: 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt)
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) SubClassOf main group molecular entity
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) SubClassOf polyatomic entity
+- 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) SubClassOf chemical shift standard
+
+
+
+
101Ru spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002152
+
+
+
+
+
+
+
103Rh spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002088
+
+
+
+
+
+
+
105Pd spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002153
+
+
+
+
+
+
+
107Ag spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002089
+
+
+
+
+
+
+
109Ag spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002090
+
+
+
+
+
+
+
10B spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002128
+
+
+
+
+
+
+
111Cd spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002091
+
+
+
+
+
+
+
113Cd spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002092
+
+
+
+
+
+
+
113In spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002154
+
+
+
+
+
+
+
115In spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002155
+
+
+
+
+
+
+
115Sn spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002093
+
+
+
+
+
+
+
117Sn spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002094
+
+
+
+
+
+
+
119Sn spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002095
+
+
+
+
+
+
+
11B spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002127
+
+
+
+
+
+
+
121Sb spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002156
+
+
+
+
+
+
+
123Sb spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002157
+
+
+
+
+
+
+
123Te spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002096
+
+
+
+
+
+
+
125Te spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002097
+
+
+
+
+
+
+
127I spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002158
+
+
+
+
+
+
+
129Xe spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002098
+
+
+
+
+
+
+
131Xe spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002159
+
+
+
+
+
+
+
133Cs spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002160
+
+
+
+
+
+
+
135Ba spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002161
+
+
+
+
+
+
+
137Ba spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002162
+
+
+
+
+
+
+
138La spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002163
+
+
+
+
+
+
+
139La spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002164
+
+
+
+
+
+
+
13C spectrum reference compound - http://nmrML.org/nmrCV#NMR:1000030
+
+
+
+
+
+
+
+
+
+
14N spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002126
+
+
+
+
+
+
+
15N spectrum reference compound - http://nmrML.org/nmrCV#NMR:1000036
+
+
+
+
+
+
+
+
+
+
177Hf spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002165
+
+
+
+
+
+
+
179Hf spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002166
+
+
+
+
+
+
+
17O spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002125
+
+
+
+
+
+
+
181Ta spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002167
+
+
+
+
+
+
+
183W spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002099
+
+
+
+
+
+
+
185Re spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002168
+
+
+
+
+
+
+
187Os spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002100
+
+
+
+
+
+
+
187Re spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002169
+
+
+
+
+
+
+
189Os spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002170
+
+
+
+
+
+
+
191Ir spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002171
+
+
+
+
+
+
+
193Ir spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002172
+
+
+
+
+
+
+
195Pt spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002101
+
+
+
+
+
+
+
197Au spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002173
+
+
+
+
+
+
+
199Hg spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002102
+
+
+
+
+
+
+
19F spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002083
+
+
+
+
+
+
+
1H spectrum reference compound - http://nmrML.org/nmrCV#NMR:1000026
+
+
+
+
+
+
+
+
+
+
2,2-Dimethyl-2-silapentane-5-sulfonate - http://nmrML.org/nmrCV#NMR:1000027
+
+
+
+
+
+
+
+
+
+
201Hg spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002174
+
+
+
+
+
+
+
203Ti spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002103
+
+
+
+
+
+
+
205Ti spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002104
+
+
+
+
+
+
+
207Pb spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002105
+
+
+
+
+
+
+
209Bi spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002175
+
+
+
+
+
+
+
21Ne spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002124
+
+
+
+
+
+
+
23Na spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002123
+
+
+
+
+
+
+
25Mg spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002122
+
+
+
+
+
+
+
27Al spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002121
+
+
+
+
+
+
+
29Si spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002084
+
+
+
+
+
+
+
2D J-resolved spectrum - http://nmrML.org/nmrCV#NMR:1000086
+
+
+
+
+
+
+
2H spectrum reference compound - http://nmrML.org/nmrCV#NMR:1000431
+
+
+
+
+
+
+
+
+
+
3-(trimethylsilyl)propane-1-sulfonate - http://purl.obolibrary.org/obo/CHEBI_228806
+
+
+
+
+
+
+
3-(trimethylsilyl)propane-1-sulfonic acid - http://purl.obolibrary.org/obo/CHEBI_85362
+
+
+
+
+
+
+
3-(trimethylsilyl)propionic acid - http://purl.obolibrary.org/obo/CHEBI_85487
+
+
+
+
+
+
+
31P spectrum reference compound - http://nmrML.org/nmrCV#NMR:1000058
+
+
+
+
+
+
+
+
+
+
33S spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002120
+
+
+
+
+
+
+
35Cl spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002119
+
+
+
+
+
+
+
37Cl spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002118
+
+
+
+
+
+
+
39K spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002117
+
+
+
+
+
+
+
3H spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002008
+
+
+
+
+
+
+
3He spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002082
+
+
+
+
+
+
+
40K spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002116
+
+
+
+
+
+
+
41K spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002115
+
+
+
+
+
+
+
43Ca spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002114
+
+
+
+
+
+
+
45Sc spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002113
+
+
+
+
+
+
+
47Ti spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002112
+
+
+
+
+
+
+
49Ti spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002111
+
+
+
+
+
+
+
50V spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002110
+
+
+
+
+
+
+
51V spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002109
+
+
+
+
+
+
+
53Cr spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002108
+
+
+
+
+
+
+
55Mn spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002107
+
+
+
+
+
+
+
57Fe spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002085
+
+
+
+
+
+
+
59Co spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002106
+
+
+
+
+
+
+
61Ni spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002133
+
+
+
+
+
+
+
63Cu spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002134
+
+
+
+
+
+
+
65Cu spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002135
+
+
+
+
+
+
+
67Zn spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002136
+
+
+
+
+
+
+
69Ga spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002137
+
+
+
+
+
+
+
6Li spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002132
+
+
+
+
+
+
+
71Ga spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002138
+
+
+
+
+
+
+
73Ge spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002139
+
+
+
+
+
+
+
75As spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002140
+
+
+
+
+
+
+
77Se spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002086
+
+
+
+
+
+
+
79Br spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002141
+
+
+
+
+
+
+
7Li spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002131
+
+
+
+
+
+
+
81Br spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002142
+
+
+
+
+
+
+
83Kr spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002143
+
+
+
+
+
+
+
85Rb spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002144
+
+
+
+
+
+
+
87Rb spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002145
+
+
+
+
+
+
+
87Sr spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002000
+
+
+
+
+
+
+
89Y spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002087
+
+
+
+
+
+
+
91Zr spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002146
+
+
+
+
+
+
+
93Nb spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002147
+
+
+
+
+
+
+
95Mo spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002148
+
+
+
+
+
+
+
97Mo spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002149
+
+
+
+
+
+
+
99Ru spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002151
+
+
+
+
+
+
+
99Tc spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002150
+
+
+
+
+
+
+
9Be spectrum chemical shift reference compound - http://nmrML.org/nmrCV#NMR:0002130
+
+
+
+
+
+
+
Acorn NMR Inc - http://nmrML.org/nmrCV#NMR:1400270
+
+
+
+
+
+
+
+
+
+
Agilent NMR instrument - http://nmrML.org/nmrCV#NMR:1000400
+
+
+
+
+
+
+
Agilent Technologies - http://nmrML.org/nmrCV#NMR:1400309
+
+
+
+
+
+
+
+
+
+
Ammonium pertechnetate - http://purl.obolibrary.org/obo/CHEBI_231509
+
+
+
+
+
+
+
Andrea Porzel - https://orcid.org/0000-0002-8148-6895
+
+
+
+
+
+
+
Annick Moing - https://orcid.org/0000-0003-1144-3600
+
+
+
+
+
+
+
Applied Biosystems - http://nmrML.org/nmrCV#NMR:1400316
+
+
+
+
+
+
+
+
+
+
BFO CLIF specification label - http://purl.obolibrary.org/obo/BFO_0000180
+
+
+
+
+
+
+
BFO OWL specification label - http://purl.obolibrary.org/obo/BFO_0000179
+
+
+
+
+
+
+
BRAND_NAME - http://purl.obolibrary.org/obo/chebi#BRAND_NAME
+
+
+
+
+
+
+
Bismut(III)-nitrat - http://purl.obolibrary.org/obo/CHEBI_231538
+
+
+
+
+
+
+
Boron trifluoride etherate - http://purl.obolibrary.org/obo/CHEBI_231495
+
+
+
+
+
+
+
Bruker - http://nmrML.org/nmrCV#NMR:1400256
+
+
+
+
+
+
+
+
+
+
Bruker AutoClean - http://nmrML.org/nmrCV#NMR:1400205
+
+
+
+
+
+
+
Bruker MATCH - http://nmrML.org/nmrCV#NMR:1400211
+
+
+
+
+
+
+
Bruker NMR instrument - http://nmrML.org/nmrCV#NMR:1400198
+
+
+
+
+
+
+
Bruker NMR magnet - http://nmrML.org/nmrCV#NMR:1400186
+
+
+
+
+
+
+
Bruker NMR probe - http://nmrML.org/nmrCV#NMR:1400231
+
+
+
+
+
+
+
Bruker autosampler - http://nmrML.org/nmrCV#NMR:1400209
+
+
+
+
+
+
+
Bruker tube - http://nmrML.org/nmrCV#NMR:1000271
+
+
+
+
+
+
+
Capillary LC-NMR - http://nmrML.org/nmrCV#NMR:1400279
+
+
+
+
+
+
+
+
+
+
Catherine Deborde - https://orcid.org/0000-0001-5687-9059
+
+
+
+
+
+
+
Chemagnetics - http://nmrML.org/nmrCV#NMR:0003006
+
+
+
+
+
+
+
Chloroform-d - http://nmrML.org/nmrCV#NMR:1000017
+
+
+
+
+
+
+
+
+
+
Chloroform-d1 - http://nmrML.org/nmrCV#NMR:1000033
+
+
+
+
+
+
+
+
+
+
Cu(MeCN)4ClO4 - http://purl.obolibrary.org/obo/CHEBI_231503
+
+
+
+
+
+
+
Daniel Jacob - https://orcid.org/0000-0002-6687-7169
+
+
+
+
+
+
+
David S Wishart - https://orcid.org/0000-0002-3207-2434
+
+
+
+
+
+
+
Deutero - http://nmrML.org/nmrCV#NMR:0003004
+
+
+
+
+
+
+
Doty Scientific - http://nmrML.org/nmrCV#NMR:1400264
+
+
+
+
+
+
+
+
+
+
EL++ ontology module - http://purl.obolibrary.org/obo/IAO_8000020
+
+
+
+
+
+
+
FOSS - http://nmrML.org/nmrCV#NMR:1400307
+
+
+
+
+
+
+
+
+
+
General Electric - http://nmrML.org/nmrCV#NMR:1000390
+
+
+
+
+
+
+
+
+
+
Hexafluorobenzene - http://nmrML.org/nmrCV#NMR:1000016
+
+
+
+
+
+
+
+
+
+
Homo sapiens - http://purl.obolibrary.org/obo/NCBITaxon_9606
+
+
+
+
+
+
+
Hyphenated NMR instrument - http://nmrML.org/nmrCV#NMR:1400200
+
+
+
+
+
+
+
+
+
+
IUPAC_NAME - http://purl.obolibrary.org/obo/chebi#IUPAC_NAME
+
+
+
+
+
+
+
International Nonproprietary Name - http://purl.obolibrary.org/obo/OMO_0003010
+
+
+
+
+
+
+
JEOL - http://nmrML.org/nmrCV#NMR:1400258
+
+
+
+
+
+
+
+
+
+
JEOL NMR instrument - http://nmrML.org/nmrCV#NMR:1400226
+
+
+
+
+
+
+
JEOL NMR probe - http://nmrML.org/nmrCV#NMR:1400232
+
+
+
+
+
+
+
JEOL magnet - http://nmrML.org/nmrCV#NMR:1000272
+
+
+
+
+
+
+
JNM-ECX Series FT NMR instrument - http://nmrML.org/nmrCV#NMR:1000368
+
+
+
+
+
+
+
+
+
+
JS Research - http://nmrML.org/nmrCV#NMR:1400266
+
+
+
+
+
+
+
+
+
+
Jasco - http://nmrML.org/nmrCV#NMR:1400308
+
+
+
+
+
+
+
+
+
+
Kaliumhexachloroantimonat(V) - http://purl.obolibrary.org/obo/CHEBI_231513
+
+
+
+
+
+
+
Kimble Chase - http://nmrML.org/nmrCV#NMR:1000391
+
+
+
+
+
+
+
+
+
+
LC MS NMR - http://nmrML.org/nmrCV#NMR:1400277
+
+
+
+
+
+
+
+
+
+
MR Resources - http://nmrML.org/nmrCV#NMR:1400259
+
+
+
+
+
+
+
+
+
+
Magritek - http://nmrML.org/nmrCV#NMR:0003001
+
+
+
+
+
+
+
N,N-dimethylformamide-d7 - http://purl.obolibrary.org/obo/CHEBI_193040
+
+
+
+
+ - N,N-dimethylformamide-d7 has related synonym "heptadeutero-N,N-dimethylformamide"
+- N,N-dimethylformamide-d7 database_cross_reference "CAS:4472-41-7"
+- N,N-dimethylformamide-d7 has_obo_namespace "chebi_ontology"
+- N,N-dimethylformamide-d7 charge "0"
+- N,N-dimethylformamide-d7 inchikey "ZMXDDKWLCZADIW-YYWVXINBSA-N"
+- N,N-dimethylformamide-d7 has related synonym "DMF-d7"
+- N,N-dimethylformamide-d7 id "CHEBI:193040"
+- N,N-dimethylformamide-d7 smiles "O=C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]"
+- N,N-dimethylformamide-d7 has related synonym "deuterated DMF"
+- N,N-dimethylformamide-d7 inchi "InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3,3D"
+- N,N-dimethylformamide-d7 mass "80.138"
+- N,N-dimethylformamide-d7 label "N,N-dimethylformamide-d7"
+- N,N-dimethylformamide-d7 monoisotopicmass "80.09670"
+- N,N-dimethylformamide-d7 formula "C3D7NO"
+- N,N-dimethylformamide-d7 database_cross_reference "Wikipedia:https://en.wikipedia.org/wiki/Deuterated_DMF"
+- N,N-dimethylformamide-d7 inSubset _STAR
+- N,N-dimethylformamide-d7 has_exact_synonym "1-deuterio-N,N-bis(trideuteriomethyl)formamide"
+- Class: N,N-dimethylformamide-d7
+- N,N-dimethylformamide-d7 SubClassOf NMR solvent
+- N,N-dimethylformamide-d7 SubClassOf deuterated compound
+- N,N-dimethylformamide-d7 SubClassOf polyatomic entity
+- N,N-dimethylformamide-d7 SubClassOf main group molecular entity
+
+
+
+
NFDI4Chem - https://www.wikidata.org/wiki/Q96678459
+
+
+
+
+
+
+
NMR Service - http://nmrML.org/nmrCV#NMR:0003003
+
+
+
+
+
+
+
NMR buffer - http://nmrML.org/nmrCV#NMR:1000331
+
+
+
+
+
+
+
+
+
+
NMR calibration compound role - http://nmrML.org/nmrCV#NMR:0002005
+
+
+
+
+
+
+
NMR characterized compound role - http://nmrML.org/nmrCV#NMR:0002002
+
+
+
+
+
+
+
NMR chemical shift calibration compound role - http://nmrML.org/nmrCV#NMR:0002006
+
+
+
+
+
+
+
NMR chemical shift reference compound - http://purl.obolibrary.org/obo/CHEBI_228364
+
+
+
+
+
+
+
NMR concentration calibration compound role - http://nmrML.org/nmrCV#NMR:0002007
+
+
+
+
+
+
+
NMR instrument - http://nmrML.org/nmrCV#NMR:1400059
+
+
+
+
+
+
+
+
+
+
NMR instrument manufacturer - http://nmrML.org/nmrCV#NMR:1400255
+
+
+
+
+
+
+
+
+
+
NMR instrument type - http://nmrML.org/nmrCV#NMR:1000012
+
+
+
+
+
+
+
+
+
+
NMR magnet - http://nmrML.org/nmrCV#NMR:1400185
+
+
+
+
+
+
+
NMR probe - http://nmrML.org/nmrCV#NMR:1400014
+
+
+
+
+
+
+
NMR pulse sequence - http://nmrML.org/nmrCV#NMR:1400037
+
+
+
+
+
+
+
+
+
+
NMR sample - http://nmrML.org/nmrCV#NMR:1400128
+
+
+
+ - NMR sample comment "def: A sample that has been prepared for chemical analysis by NMR. NMR samples are usually liquid solutions contained in glass tubes. NMR solution sample volume ranges from 50ul to 5ml depending on the NMR probe. Sample concentrations of solute for 1H NMR are usually in the range of 100ug to 5g, with 10 to 50mg being typical. NMR is not a chemical trace analysis technique. The NMR signal of solids and gases can be recorded but to measure solid-state NMR additional specialized hardware is required.
+ synonym: NMR sample"^^string
+
+
+
+
+
+
+
+
NMR sample holder - http://nmrML.org/nmrCV#NMR:1400212
+
+
+
+
+
+
+
NMR sample tube - http://nmrML.org/nmrCV#NMR:1400132
+
+
+
+
+
+
+
NMR shift reagent - http://purl.obolibrary.org/obo/CHEBI_67137
+
+
+
+
+
+
+
NMR solvent - http://purl.obolibrary.org/obo/CHEBI_197449
+
+
+
+
+
+
+
NMR solvent - http://nmrML.org/nmrCV#NMR:1000330
+
+
+
+
+
+
+
+
+
+
NMR tube washing system - http://nmrML.org/nmrCV#NMR:1400204
+
+
+
+
+
+
+
Nalorac - http://nmrML.org/nmrCV#NMR:0003007
+
+
+
+
+
+
+
Nanalysis - http://nmrML.org/nmrCV#NMR:0003002
+
+
+
+
+
+
+
Norell tube - http://nmrML.org/nmrCV#NMR:1000297
+
+
+
+
+
+
+
Norell® - http://nmrML.org/nmrCV#NMR:0003005
+
+
+
+
+
+
+
Noura Rayya - https://orcid.org/0009-0001-5998-5030
+
+
+
+
+
+
+
OBO foundry unique label - http://purl.obolibrary.org/obo/IAO_0000589
+
+
+
+
+
+
+
ObsoleteClass - http://www.geneontology.org/formats/oboInOwl#ObsoleteClass
+
+
+
+
+
+
+
OceanOptics - http://nmrML.org/nmrCV#NMR:1400314
+
+
+
+
+
+
+
+
+
+
Oxford Instruments - http://nmrML.org/nmrCV#NMR:1000388
+
+
+
+
+
+
+
+
+
+
Perkin Elmer - http://nmrML.org/nmrCV#NMR:1400313
+
+
+
+
+
+
+
+
+
+
Philip Strömert - https://orcid.org/0000-0002-1595-3213
+
+
+
+
+
+
+
Philippe Rocca-Serra - https://orcid.org/0000-0001-9853-5668
+
+
+
+
+
+
+
Phillips - http://nmrML.org/nmrCV#NMR:1000392
+
+
+
+
+
+
+
+
+
+
Potassium cobalticyanide - http://purl.obolibrary.org/obo/CHEBI_231502
+
+
+
+
+
+
+
Potassium hexachloropalladate(IV) - http://purl.obolibrary.org/obo/CHEBI_231511
+
+
+
+
+
+
+
Potassium hexacyanoruthenate(ii) - http://purl.obolibrary.org/obo/CHEBI_231510
+
+
+
+
+
+
+
Potassium perrhenate - http://purl.obolibrary.org/obo/CHEBI_231537
+
+
+
+
+
+
+
Potassium;tantalum(5+);hexachloride - http://purl.obolibrary.org/obo/CHEBI_231536
+
+
+
+
+
+
+
RO_0001900 - http://purl.obolibrary.org/obo/RO_0001900
+
+
+
+
+
+
+
RO_0040042 - http://purl.obolibrary.org/obo/RO_0040042
+
+
+
+
+
+
+
Reza Salek - https://orcid.org/0000-0001-8604-1732
+
+
+
+
+
+
+
Rules
+
+
+
+
+ - role(?d), has characteristic(?e, ?d) -> has role(?e, ?d)
+- quality(?d), has characteristic(?e, ?d) -> has quality(?e, ?d)
+- disposition(?d), has characteristic(?e, ?d) -> has disposition(?e, ?d)
+- function(?d), has characteristic(?e, ?d) -> has function(?e, ?d)
+
+
+
+
Siemens AG - http://nmrML.org/nmrCV#NMR:1000393
+
+
+
+
+
+
+
+
+
+
Sodium hexafluoroarsenate - http://purl.obolibrary.org/obo/CHEBI_231507
+
+
+
+
+
+
+
Spinlock SRL - http://nmrML.org/nmrCV#NMR:1000389
+
+
+
+
+
+
+
+
+
+
Steffen Neumann - https://orcid.org/0000-0002-7899-7192
+
+
+
+
+
+
+
SubsetProperty - http://www.geneontology.org/formats/oboInOwl#SubsetProperty
+
+
+
+
+
+
+
Susanna-Assunta Sansone - https://orcid.org/0000-0001-5306-5690
+
+
+
+
+
+
+
SynonymTypeProperty - http://www.geneontology.org/formats/oboInOwl#SynonymTypeProperty
+
+
+
+
+
+
+
TX - http://nmrML.org/nmrCV#NMR:1400317
+
+
+
+
+
+
+
+
+
+
Thermo Fischer - http://nmrML.org/nmrCV#NMR:0003000
+
+
+
+
+
+
+
ThermoFinnigan - http://nmrML.org/nmrCV#NMR:1400315
+
+
+
+
+
+
+
+
+
+
ThermoMattson - http://nmrML.org/nmrCV#NMR:1400306
+
+
+
+
+
+
+
+
+
+
ThermoNicolet - http://nmrML.org/nmrCV#NMR:1400312
+
+
+
+
+
+
+
+
+
+
Trimethylsilyl propionate - http://nmrML.org/nmrCV#NMR:1000159
+
+
+
+
+
+
+
+
+
+
UK spelling synonym - http://purl.obolibrary.org/obo/OMO_0003005
+
+
+
+
+
+
+
Vanadium oxytrichloride - http://purl.obolibrary.org/obo/CHEBI_231500
+
+
+
+
+
+
+
Varian - http://nmrML.org/nmrCV#NMR:1400257
+
+
+
+
+
+
+
+
+
+
Varian NMR instrument - http://nmrML.org/nmrCV#NMR:1400234
+
+
+
+
+
+
+
Varian autosampler - http://nmrML.org/nmrCV#NMR:1000233
+
+
+
+
+
+
+
Varian magnet - http://nmrML.org/nmrCV#NMR:1000302
+
+
+
+
+
+
+
Varian probe - http://nmrML.org/nmrCV#NMR:1000235
+
+
+
+
+
+
+
Vendor2nmrML_Java - http://nmrML.org/nmrCV#NMR:1000301
+
+
+
+ - Vendor2nmrML_Java definition "Based on both nmrML.xsd (XML Schema Definition) and CV params (such as ontologies nmrCV, UO, CHEBI ...), a converter written in Java was developed that automatically generates nmrML files, from raw files of the major NMR vendors. The choice of Java was guided by i) the JAXB framework (Java Architecture for XML Binding), ii) its OS-platform independence and iii) strengthened by the existence of a useful java library (i.e [nmr-fid-tool](https://github.com/LuisFF/nmr-fid-tool)) for further processing and visualisation of the resulting nmrML data.
+As nmrML intents to gather and integrate several types of data and corresponding metadata in a single file, it is necessary to process each data source separately. Thus, two command tools were developed.
+
+The first one, nmrMLcreate allows to create a new nmrML file, based on available Bruker or Varian/Agilent raw files.
+
+The second one, nmrMLproc allows to add and fill in additional sections corresponding to the data processing step."@en
+
+
+
+
+
+ - Vendor2nmrML_Java definition "Based on both nmrML.xsd (XML Schema Definition) and CV params (such as ontologies nmrCV, UO, CHEBI ...), a converter written in Java was developed that automatically generates nmrML files, from raw files of the major NMR vendors. The choice of Java was guided by i) the JAXB framework (Java Architecture for XML Binding), ii) its OS-platform independence and iii) strengthened by the existence of a useful java library (i.e [nmr-fid-tool](https://github.com/LuisFF/nmr-fid-tool)) for further processing and visualisation of the resulting nmrML data.
+As nmrML intents to gather and integrate several types of data and corresponding metadata in a single file, it is necessary to process each data source separately. Thus, two command tools were developed.
+
+The first one, nmrMLcreate allows to create a new nmrML file, based on available Bruker or Varian/Agilent raw files.
+
+The second one, nmrMLproc allows to add and fill in additional sections corresponding to the data processing step."@en
+
+
+
+
Waters - http://nmrML.org/nmrCV#NMR:1400311
+
+
+
+
+
+
+
+
+
+
Wilmad - http://nmrML.org/nmrCV#NMR:1400265
+
+
+
+
+
+
+
+
+
+
Wilmad tube - http://nmrML.org/nmrCV#NMR:1000278
+
+
+
+
+
+
+
Zirconocene dichloride - http://purl.obolibrary.org/obo/CHEBI_231508
+
+
+
+
+
+
+
_STAR - http://purl.obolibrary.org/obo/chebi#2_STAR
+
+
+
+
+
+
+
_STAR - http://purl.obolibrary.org/obo/chebi#3_STAR
+
+
+
+
+
+
+
abbreviation - http://purl.obolibrary.org/obo/OMO_0003000
+
+
+
+
+
+
+
abstract - http://purl.org/dc/terms/abstract
+
+
+
+
+
+
+
acdlabs - http://nmrML.org/nmrCV#NMR:1400322
+
+
+
+
+
+
+
+
+
+
acetic acid-d4 - http://purl.obolibrary.org/obo/CHEBI_193049
+
+
+
+
+
+
+
acetone d6 - http://purl.obolibrary.org/obo/CHEBI_78217
+
+
+
+
+
+
+
acetonitrile - http://nmrML.org/nmrCV#NMR:1000024
+
+
+
+
+
+
+
+
+
+
acetonitrile - http://purl.obolibrary.org/obo/CHEBI_38472
+
+
+
+
+
+
+
acetonitrile-d3 - http://purl.obolibrary.org/obo/CHEBI_193038
+
+
+
+
+
+
+
achieves_planned_objective - http://purl.obolibrary.org/obo/OBI_0000417
+
+
+
+
+
+
+
acquisition computer - http://nmrML.org/nmrCV#NMR:1400013
+
+
+
+
+
+
+
+
+
+
acquisition nucleus - http://nmrML.org/nmrCV#NMR:1400083
+
+
+
+
+
+
+
+
+
+
acronym - http://purl.obolibrary.org/obo/OMO_0003012
+
+
+
+
+
+
+
action specification - http://purl.obolibrary.org/obo/IAO_0000007
+
+
+
+
+
+
+
alternative term - http://purl.obolibrary.org/obo/IAO_0000118
+
+
+
+
+
+
+
aluminium-27 atom - http://purl.obolibrary.org/obo/CHEBI_37968
+
+
+
+
+
+
+
ambiguous synonym - http://purl.obolibrary.org/obo/OMO_0003001
+
+
+
+
+
+
+
ammonia - http://purl.obolibrary.org/obo/CHEBI_16134
+
+
+
+
+
+
+
ammonia (liquid) - http://nmrML.org/nmrCV#NMR:1000037
+
+
+
+
+
+
+
+
+
+
ammonium bromide - http://nmrML.org/nmrCV#NMR:1000038
+
+
+
+
+
+
+
+
+
+
ammonium bromide - http://purl.obolibrary.org/obo/CHEBI_85364
+
+
+
+
+
+
+
ammonium sulfate - http://purl.obolibrary.org/obo/CHEBI_62946
+
+
+
+
+
+
+
analysis subset ontology module - http://purl.obolibrary.org/obo/IAO_8000008
+
+
+
+
+
+
+
antimony pentafluoride - http://purl.obolibrary.org/obo/CHEBI_193146
+
+
+
+
+
+
+
antimony-121 atom - http://purl.obolibrary.org/obo/CHEBI_52624
+
+
+
+
+
+
+
antimony-123 atom - http://purl.obolibrary.org/obo/CHEBI_52626
+
+
+
+
+
+
+
antisymmetric property - http://purl.obolibrary.org/obo/IAO_0000427
+
+
+
+
+
+
+
application - http://purl.obolibrary.org/obo/CHEBI_33232
+
+
+
+
+
+
+
arsenic-75 atom - http://purl.obolibrary.org/obo/CHEBI_176584
+
+
+
+
+
+
+
atom - http://purl.obolibrary.org/obo/CHEBI_33250
+
+
+
+
+
+
+
atomic nucleus - http://purl.obolibrary.org/obo/CHEBI_33252
+
+
+
+
+
+
+
audience - http://usefulinc.com/ns/doap#audience
+
+
+
+
+
+
+
autosampler - http://nmrML.org/nmrCV#NMR:1400002
+
+
+
+ - autosampler comment "def: An optional part of an NMR instrument used to hold samples prior to NMR analysis and that sequentially loads these samples into the analytical part of the NMR instrument.
+ altdef: The autosampler is an automatic sample changer."^^string
+- autosampler label "autosampler"^^string
+
+
+
+
+
+ - autosampler comment "def: An optional part of an NMR instrument used to hold samples prior to NMR analysis and that sequentially loads these samples into the analytical part of the NMR instrument.
+ altdef: The autosampler is an automatic sample changer."
+- autosampler term tracker item 12
+- autosampler label "NMR autosampler"
+
+
+
+
barium chloride - http://purl.obolibrary.org/obo/CHEBI_63317
+
+
+
+
+
+
+
base ontology module - http://purl.obolibrary.org/obo/IAO_8000001
+
+
+
+
+
+
+
benzene-d6 - http://purl.obolibrary.org/obo/CHEBI_193039
+
+
+
+
+ - benzene-d6 has_obo_namespace "chebi_ontology"
+- benzene-d6 charge "0"
+- benzene-d6 has related synonym "perdeuterobenzene"
+- benzene-d6 label "benzene-d6"
+- benzene-d6 id "CHEBI:193039"
+- benzene-d6 inSubset _STAR
+- benzene-d6 monoisotopicmass "84.08461"
+- benzene-d6 has related synonym "hexadeuterobenzene"
+- benzene-d6 database_cross_reference "CAS:1076-43-3"
- source "NIST Chemistry WebBook"
+- benzene-d6 inchikey "UHOVQNZJYSORNB-MZWXYZOWSA-N"
+- benzene-d6 database_cross_reference "Wikipedia:Deuterated_benzene"
+- benzene-d6 database_cross_reference "CAS:1076-43-3"
+- benzene-d6 smiles "C1(=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])[2H]"
+- benzene-d6 has related synonym "Benzol-d6"
+- benzene-d6 inchi "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,2D,3D,4D,5D,6D"
+- benzene-d6 has_exact_synonym "((2)H6)benzene"
+- benzene-d6 formula "C6D6"
+- benzene-d6 has related synonym "1,2,3,4,5,6-hexadeuteriobenzene"
+- benzene-d6 mass "84.151"
+- benzene-d6 has related synonym "benzene-1,2,3,4,5,6-d6"
+- Class: benzene-d6
+- benzene-d6 SubClassOf polyatomic entity
+- benzene-d6 SubClassOf NMR solvent
+- benzene-d6 SubClassOf main group molecular entity
+- benzene-d6 SubClassOf deuterated compound
+
+
+
+
beryllium sulfate - http://purl.obolibrary.org/obo/CHEBI_53473
+
+
+
+
+
+
+
bridge ontology module - http://purl.obolibrary.org/obo/IAO_8000004
+
+
+
+
+
+
+
bromine pentafluoride - http://purl.obolibrary.org/obo/CHEBI_193148
+
+
+
+
+
+
+
bromine-79 atom - http://purl.obolibrary.org/obo/CHEBI_52743
+
+
+
+
+
+
+
bucketing - http://nmrML.org/nmrCV#NMR:1400138
+
+
+
+ - bucketing comment "def: A post-processing method that divides a pre-processed NMR spectrum into a series of buckets (or bins) along the x-axis, and then integrates the spectral intensity within each bucket.
+ altdef: A type of automated integration which occurs across pre-defined regions for a spectrum."^^string
+
+
+
+
+
+ - bucketing comment "def: A post-processing method that divides a pre-processed NMR spectrum into a series of buckets (or bins) along the x-axis, and then integrates the spectral intensity within each bucket.
+ altdef: A type of automated integration which occurs across pre-defined regions for a spectrum."
+
+
+
+
cadmium-111 - http://purl.obolibrary.org/obo/CHEBI_52619
+
+
+
+
+
+
+
cadmium-113 - http://purl.obolibrary.org/obo/CHEBI_52620
+
+
+
+
+
+
+
caesium nitrate - http://purl.obolibrary.org/obo/CHEBI_231514
+
+
+
+
+
+
+
calcium dichloride - http://purl.obolibrary.org/obo/CHEBI_3312
+
+
+
+
+
+
+
calcium-43 atom - http://purl.obolibrary.org/obo/CHEBI_176566
+
+
+
+
+
+
+
calibration compound - http://nmrML.org/nmrCV#NMR:1400032
+
+
+
+
+
+
+
+
+
+
carbon-13 atom - http://purl.obolibrary.org/obo/CHEBI_36928
+
+
+
+
+
+
+
cardinal part of NMR instrument - http://nmrML.org/nmrCV#NMR:1400011
+
+
+
+
+
+
+
+
+
+
characteristic of - http://purl.obolibrary.org/obo/RO_0000052
+
+
+
+
+
+
+
characteristic of part of - http://purl.obolibrary.org/obo/RO_0002314
+
+
+
+
+
+
+
characterized compound - http://nmrML.org/nmrCV#NMR:0002001
+
+
+
+
+
+
+
charge - http://purl.obolibrary.org/obo/chebi/charge
+
+
+
+
+ - AnnotationProperty: charge
+
+
+
+
chemical compound - http://nmrML.org/nmrCV#NMR:1000881
+
+
+
+
+
+
+
+
+
+
chemical role - http://purl.obolibrary.org/obo/CHEBI_51086
+
+
+
+
+
+
+
chemical shift calibration compound - http://nmrML.org/nmrCV#NMR:0002003
+
+
+
+
+
+
+
chemical shift standard - http://nmrML.org/nmrCV#NMR:1400033
+
+
+
+ - chemical shift standard comment "def: A compound that is added to an NMR sample to enable the alignment of spectra. The power of NMR is that for most nuclei the NMR frequency changes very slightly with different molecular environment or chemical bonding. These shifts are very small, on the order of 1 part in 10+9. This is referred to as "Chemical Shift." Tables of chemical shifts are tabulated and used to determine molecular structure. Combining NMR chemical shift information with other NMR information such as peak integration, coupling constants and Nuclear Overhauser Enhancement (NOE) can result in complete three-dimensional molecular structures of molecules in solution without using X-ray crystallography."^^string
+- chemical shift standard label "chemical shift standard"^^string
+- chemical shift standard has_exact_synonym "chemical shift reference compound"
+- chemical shift standard SubClassOf calibration compound
+
+
+
+
+
+
+
+
chemical substance - http://purl.obolibrary.org/obo/CHEBI_59999
+
+
+
+
+
+
+
cobalt-59 atom - http://purl.obolibrary.org/obo/CHEBI_176578
+
+
+
+
+
+
+
comment - http://www.w3.org/2000/01/rdf-schema#comment
+
+
+
+
+
+
+
computer - http://purl.obolibrary.org/obo/OBI_0400107
+
+
+
+
+
+
+
concentration standard - http://nmrML.org/nmrCV#NMR:1000167
+
+
+
+
+
+
+
+
+
+
concretizes - http://purl.obolibrary.org/obo/RO_0000059
+
+
+
+
+ - concretizes label "concretizes"@en
+- concretizes definition "A relationship between a specifically dependent continuant or process and a generically dependent continuant, in which the generically dependent continuant depends on some independent continuant in virtue of the fact that the specifically dependent continuant or process also depends on that same independent continuant. Multiple specifically dependent continuants or processes can concretize the same generically dependent continuant."@en
+- concretizes definition "A relationship between a specifically dependent continuant and a generically dependent continuant, in which the generically dependent continuant depends on some independent continuant in virtue of the fact that the specifically dependent continuant also depends on that same independent continuant. Multiple specifically dependent continuants can concretize the same generically dependent continuant."@en
+- concretizes example of usage "A journal article is an information artifact that inheres in some number of printed journals. For each copy of the printed journal there is some quality that carries the journal article, such as a pattern of ink. The quality (a specifically dependent continuant) concretizes the journal article (a generically dependent continuant), and both depend on that copy of the printed journal (an independent continuant)."@en
+- concretizes example of usage "An investigator reads a protocol and forms a plan to carry out an assay. The plan is a realizable entity (a specifically dependent continuant) that concretizes the protocol (a generically dependent continuant), and both depend on the investigator (an independent continuant). The plan is then realized by the assay (a process)."@en
+- ObjectProperty: concretizes
+- concretizes Domain specifically dependent continuant
+- concretizes Domain process or specifically dependent continuant
+- concretizes Range generically dependent continuant
+
+
+
+
console - http://nmrML.org/nmrCV#NMR:1400015
+
+
+
+
+
+
+
+
+
+
consume data function - http://purl.obolibrary.org/obo/OBI_0000455
+
+
+
+
+
+
+
contain function - http://purl.obolibrary.org/obo/OBI_0000370
+
+
+
+
+
+
+
container - http://purl.obolibrary.org/obo/OBI_0000967
+
+
+
+
+
+
+
continuant - http://purl.obolibrary.org/obo/BFO_0000002
+
+
+
+
+ - continuant has associated axiom(nl) "if b is a material entity, then there is some temporal interval (referred to below as a one-dimensional temporal region) during which b exists. (axiom label in BFO2 Reference: [011-002])"@en
+- continuant has associated axiom(fol) "(forall (x) (if (Material Entity x) (exists (t) (and (TemporalRegion t) (existsAt x t))))) // axiom label in BFO2 CLIF: [011-002] "
+- continuant label "continuant"@en
+- continuant has associated axiom(nl) "if b is a continuant and if, for some t, cis continuant_part of b at t, then c is a continuant. (axiom label in BFO2 Reference: [009-002])"@en
+- continuant editor note "Continuant doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. For example, in an expansion involving bringing in some of Ceuster's other portions of reality, questions are raised as to whether universals are continuants"@en
+- continuant editor note "BFO 2 Reference: Continuant entities are entities which can be sliced to yield parts only along the spatial dimension, yielding for example the parts of your table which we call its legs, its top, its nails. ‘My desk stretches from the window to the door. It has spatial parts, and can be sliced (in space) in two. With respect to time, however, a thing is a continuant.’ [60, p. 240"@en
+- continuant elucidation "A continuant is an entity that persists, endures, or continues to exist through time while maintaining its identity. (axiom label in BFO2 Reference: [008-002])"@en
+- continuant BFO CLIF specification label "Continuant"
+- continuant has associated axiom(nl) "if b is a continuant and if, for some t, c has_continuant_part b at t, then c is a continuant. (axiom label in BFO2 Reference: [126-001])"@en
+- continuant BFO OWL specification label "continuant"
+- continuant has associated axiom(fol) "(forall (x y) (if (and (Continuant x) (exists (t) (hasContinuantPartOfAt y x t))) (Continuant y))) // axiom label in BFO2 CLIF: [126-001] "
+- continuant has associated axiom(fol) "(forall (x y) (if (and (Continuant x) (exists (t) (continuantPartOfAt y x t))) (Continuant y))) // axiom label in BFO2 CLIF: [009-002] "
+- continuant has associated axiom(fol) "(forall (x) (if (Continuant x) (Entity x))) // axiom label in BFO2 CLIF: [008-002] "
+- continuant definition "An entity that exists in full at any time in which it exists at all, persists through time while maintaining its identity and has no temporal parts."@en
+- continuant isDefinedBy bfo.owl
+- Class: continuant
+- continuant DisjointWith part of some occurrent
+- continuant DisjointWith occurrent
+- continuant SubClassOf entity
+
+
+
+
continuant fiat boundary - http://purl.obolibrary.org/obo/BFO_0000140
+
+
+
+
+ - continuant fiat boundary editor note "Continuant fiat boundary doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. An example would be the mereological sum of two-dimensional continuant fiat boundary and a one dimensional continuant fiat boundary that doesn't overlap it. The situation is analogous to temporal and spatial regions."@en
+- continuant fiat boundary BFO CLIF specification label "ContinuantFiatBoundary"
+- continuant fiat boundary has associated axiom(fol) "(iff (ContinuantFiatBoundary a) (and (ImmaterialEntity a) (exists (b) (and (or (ZeroDimensionalSpatialRegion b) (OneDimensionalSpatialRegion b) (TwoDimensionalSpatialRegion b)) (forall (t) (locatedInAt a b t)))) (not (exists (c t) (and (SpatialRegion c) (continuantPartOfAt c a t)))))) // axiom label in BFO2 CLIF: [029-001] "
+- continuant fiat boundary editor note "BFO 2 Reference: a continuant fiat boundary is a boundary of some material entity (for example: the plane separating the Northern and Southern hemispheres; the North Pole), or it is a boundary of some immaterial entity (for example of some portion of airspace). Three basic kinds of continuant fiat boundary can be distinguished (together with various combination kinds [29"@en
+- continuant fiat boundary isDefinedBy bfo.owl
+- continuant fiat boundary editor note "BFO 2 Reference: In BFO 1.1 the assumption was made that the external surface of a material entity such as a cell could be treated as if it were a boundary in the mathematical sense. The new document propounds the view that when we talk about external surfaces of material objects in this way then we are talking about something fiat. To be dealt with in a future version: fiat boundaries at different levels of granularity.More generally, the focus in discussion of boundaries in BFO 2.0 is now on fiat boundaries, which means: boundaries for which there is no assumption that they coincide with physical discontinuities. The ontology of boundaries becomes more closely allied with the ontology of regions."@en
+- continuant fiat boundary label "continuant fiat boundary"@en
+- continuant fiat boundary definition "b is a continuant fiat boundary = Def. b is an immaterial entity that is of zero, one or two dimensions and does not include a spatial region as part. (axiom label in BFO2 Reference: [029-001])"@en
+- continuant fiat boundary BFO OWL specification label "cf-boundary"
+- continuant fiat boundary has associated axiom(nl) "Every continuant fiat boundary is located at some spatial region at every time at which it exists"@en
+- Class: continuant fiat boundary
+- continuant fiat boundary SubClassOf immaterial entity
+
+
+
+
continuous wave NMR - http://nmrML.org/nmrCV#NMR:1400283
+
+
+
+
+
+
+
+
+
+
contributor - http://purl.org/dc/elements/1.1/contributor
+
+
+
+
+
+
+
contributor - http://purl.org/dc/terms/contributor
+
+
+
+
+
+
+
created - http://purl.org/dc/terms/created
+
+
+
+
+
+
+
created_by - http://www.geneontology.org/formats/oboInOwl#created_by
+
+
+
+
+
+
+
creatinine - http://nmrML.org/nmrCV#NMR:1000214
+
+
+
+
+
+
+
+
+
+
creator - http://purl.org/dc/elements/1.1/creator
+
+
+
+
+
+
+
curation status specification - http://purl.obolibrary.org/obo/IAO_0000078
+
+
+
+
+
+
+
curation subset ontology module - http://purl.obolibrary.org/obo/IAO_8000007
+
+
+
+
+
+
+
curator note - http://purl.obolibrary.org/obo/IAO_0000232
+
+
+
+
+
+
+
data about an ontology part - http://purl.obolibrary.org/obo/IAO_0000102
+
+
+
+
+
+
+
data item - http://purl.obolibrary.org/obo/IAO_0000027
+
+
+
+
+ - data item term editor "PERSON: Alan Ruttenberg"@en
+- data item definition "An information content entity that is intended to be a truthful statement about something (modulo, e.g., measurement precision or other systematic errors) and is constructed/acquired by a method which reliably tends to produce (approximately) truthful statements."@en
+- data item example of usage "Data items include counts of things, analyte concentrations, and statistical summaries."@en
+- data item label "data item"@en
+- data item term editor "PERSON: Jonathan Rees"@en
+- data item alternative term "data"@en
+- data item editor note "2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum."@en
+- data item editor note "2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym."@en
+- data item editor note "JAR: datum -- well, this will be very tricky to define, but maybe some
+information-like stuff that might be put into a computer and that is
+meant, by someone, to denote and/or to be interpreted by some
+process... I would include lists, tables, sentences... I think I might
+defer to Barry, or to Brian Cantwell Smith
+
+JAR: A data item is an approximately justified approximately true approximate belief"@en
+- data item editor preferred term "data item"@en
+- data item editor note "2/2/2009 Alan and Bjoern discussing FACS run output data. This is a data item because it is about the cell population. Each element records an event and is typically further composed a set of measurment data items that record the fluorescent intensity stimulated by one of the lasers."@en
+- data item term editor "PERSON: Chris Stoeckert"@en
+- data item editor note "2014-03-31: See discussion at http://odontomachus.wordpress.com/2014/03/30/aboutness-objects-propositions/"
+- data item has curation status pending final vetting
+- Class: data item
+- data item SubClassOf information content entity
+
+
+
+
database_cross_reference - http://www.geneontology.org/formats/oboInOwl#hasDbXref
+
+
+
+
+
+
+
date - http://purl.org/dc/terms/date
+
+
+
+
+ - AnnotationProperty: date
+
+
+
+
date - http://www.w3.org/2001/XMLSchema#date
+
+
+
+
+
+
+
date - http://purl.org/dc/elements/1.1/date
+
+
+
+
+ - AnnotationProperty: date
+
+
+
+
defaultLanguage - http://protege.stanford.edu/plugins/owl/protege#defaultLanguage
+
+
+
+
+
+
+
defined by construct - http://purl.obolibrary.org/obo/OMO_0002000
+
+
+
+
+
+
+
defined class - http://purl.obolibrary.org/obo/IAO_0000420
+
+
+
+
+
+
+
definition - http://purl.obolibrary.org/obo/IAO_0000115
+
+
+
+
+ - definition editor note "2012-04-05:
+Barry Smith
+
+The official OBI definition, explaining the meaning of a class or property: 'Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions' is terrible.
+
+Can you fix to something like:
+
+A statement of necessary and sufficient conditions explaining the meaning of an expression referring to a class or property.
+
+Alan Ruttenberg
+
+Your proposed definition is a reasonable candidate, except that it is very common that necessary and sufficient conditions are not given. Mostly they are necessary, occasionally they are necessary and sufficient or just sufficient. Often they use terms that are not themselves defined and so they effectively can't be evaluated by those criteria.
+
+On the specifics of the proposed definition:
+
+We don't have definitions of 'meaning' or 'expression' or 'property'. For 'reference' in the intended sense I think we use the term 'denotation'. For 'expression', I think we you mean symbol, or identifier. For 'meaning' it differs for class and property. For class we want documentation that let's the intended reader determine whether an entity is instance of the class, or not. For property we want documentation that let's the intended reader determine, given a pair of potential relata, whether the assertion that the relation holds is true. The 'intended reader' part suggests that we also specify who, we expect, would be able to understand the definition, and also generalizes over human and computer reader to include textual and logical definition.
+
+Personally, I am more comfortable weakening definition to documentation, with instructions as to what is desirable.
+
+We also have the outstanding issue of how to aim different definitions to different audiences. A clinical audience reading chebi wants a different sort of definition documentation/definition from a chemistry trained audience, and similarly there is a need for a definition that is adequate for an ontologist to work with."@en
+- definition has curation status ready for release
+- definition editor preferred term "definition"@en
+- definition editor note "2012-04-05:
+Barry Smith
+
+The official OBI definition, explaining the meaning of a class or property: 'Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions' is terrible.
+
+Can you fix to something like:
+
+A statement of necessary and sufficient conditions explaining the meaning of an expression referring to a class or property.
+
+Alan Ruttenberg
+
+Your proposed definition is a reasonable candidate, except that it is very common that necessary and sufficient conditions are not given. Mostly they are necessary, occasionally they are necessary and sufficient or just sufficient. Often they use terms that are not themselves defined and so they effectively can't be evaluated by those criteria.
+
+On the specifics of the proposed definition:
+
+We don't have definitions of 'meaning' or 'expression' or 'property'. For 'reference' in the intended sense I think we use the term 'denotation'. For 'expression', I think we you mean symbol, or identifier. For 'meaning' it differs for class and property. For class we want documentation that let's the intended reader determine whether an entity is instance of the class, or not. For property we want documentation that let's the intended reader determine, given a pair of potential relata, whether the assertion that the relation holds is true. The 'intended reader' part suggests that we also specify who, we expect, would be able to understand the definition, and also generalizes over human and computer reader to include textual and logical definition.
+
+Personally, I am more comfortable weakening definition to documentation, with instructions as to what is desirable.
+
+We also have the outstanding issue of how to aim different definitions to different audiences. A clinical audience reading chebi wants a different sort of definition documentation/definition from a chemistry trained audience, and similarly there is a need for a definition that is adequate for an ontologist to work with. "@en
+- definition definition "The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions."@en
+- definition label "definition"@en
+- definition isDefinedBy iao.owl
+- definition definition source "GROUP:OBI:<http://purl.obolibrary.org/obo/obi>"@en
+- definition term editor "PERSON:Daniel Schober"@en
+
+
+
+
definition source - http://purl.obolibrary.org/obo/IAO_0000119
+
+
+
+
+
+
+
denotator type - http://purl.obolibrary.org/obo/IAO_0000409
+
+
+
+
+
+
+
depends on - http://purl.obolibrary.org/obo/RO_0002502
+
+
+
+
+
+
+
description - http://purl.org/dc/terms/description
+
+
+
+
+
+
+
description - http://purl.org/dc/elements/1.1/description
+
+
+
+
+
+
+
deuterated chloroform - http://purl.obolibrary.org/obo/CHEBI_85365
+
+
+
+
+
+
+
deuterated compound - http://purl.obolibrary.org/obo/CHEBI_76107
+
+
+
+
+
+
+
deuterium atom - http://purl.obolibrary.org/obo/CHEBI_29237
+
+
+
+
+
+
+
device - http://purl.obolibrary.org/obo/OBI_0000968
+
+
+
+
+ - device definition source "OBI development call 2012-12-17."
+- device editor note "2012-12-17 JAO: In common lab usage, there is a distinction made between devices and reagents that is difficult to model. Therefore we have chosen to specifically exclude reagents from the definition of "device", and are enumerating the types of roles that a reagent can perform.
+
+2013-6-5 MHB: The following clarifications are outcomes of the May 2013 Philly Workshop. Reagents are distinguished from devices that also participate in scientific techniques by the fact that reagents are chemical or biological in nature and necessarily participate in some chemical interaction or reaction during the realization of their experimental role. By contrast, devices do not participate in such chemical reactions/interactions. Note that there are cases where devices use reagent components during their operation, where the reagent-device distinction is less clear. For example:
+
+(1) An HPLC machine is considered a device, but has a column that holds a stationary phase resin as an operational component. This resin qualifies as a device if it participates purely in size exclusion, but bears a reagent role that is realized in the running of a column if it interacts electrostatically or chemically with the evaluant. The container the resin is in (“the column”) considered alone is a device. So the entire column as well as the entire HPLC machine are devices that have a reagent as an operating part.
+
+(2) A pH meter is a device, but its electrode component bears a reagent role in virtue of its interacting directly with the evaluant in execution of an assay.
+
+(3) A gel running box is a device that has a metallic lead as a component that participates in a chemical reaction with the running buffer when a charge is passed through it. This metallic lead is considered to have a reagent role as a component of this device realized in the running of a gel.
+
+In the examples above, a reagent is an operational component of a device, but the device itself does not realize a reagent role (as bearing a reagent role is not transitive across the part_of relation). In this way, the asserted disjointness between a reagent and device holds, as both roles are never realized in the same bearer during execution of an assay."
+- device has curation status ready for release
+- device alternative term "instrument"
+- device example of usage "A voltmeter is a measurement device which is intended to perform some measure function."
+- device definition "A material entity that is designed to perform a function in a scientific investigation, but is not a reagent."@en
+- device label "device"
+- device example of usage "An autoclave is a device that sterlizes instruments or contaminated waste by applying high temperature and pressure."
+- device term editor "PERSON: Helen Parkinson"
+- device editor preferred term "device"
+- Class: device
+- device SubClassOf processed material
+- device SubClassOf has function some function
+
+
+
+
dichloromethane-d2 - http://purl.obolibrary.org/obo/CHEBI_193042
+
+
+
+
+
+
+
dideuterium oxide - http://purl.obolibrary.org/obo/CHEBI_41981
+
+
+
+
+
+
+
difluorine - http://purl.obolibrary.org/obo/CHEBI_30236
+
+
+
+
+
+
+
dimethyl ether-d6 - http://purl.obolibrary.org/obo/CHEBI_193135
+
+
+
+
+
+
+
dimethyl sulfoxide-d6 - http://purl.obolibrary.org/obo/CHEBI_193041
+
+
+
+
+
+
+
dimethyl telluride - http://purl.obolibrary.org/obo/CHEBI_4613
+
+
+
+
+
+
+
dimethylcadmium - http://purl.obolibrary.org/obo/CHEBI_229455
+
+
+
+
+
+
+
dimethylmercury - http://purl.obolibrary.org/obo/CHEBI_30786
+
+
+
+
+
+
+
dimethylselenide - http://purl.obolibrary.org/obo/CHEBI_4610
+
+
+
+
+
+
+
directive information entity - http://purl.obolibrary.org/obo/IAO_0000033
+
+
+
+
+
+
+
disposition - http://purl.obolibrary.org/obo/BFO_0000016
+
+
+
+
+
+
+
disposition of - http://purl.obolibrary.org/obo/RO_0000092
+
+
+
+
+
+
+
documenter - http://usefulinc.com/ns/doap#documenter
+
+
+
+
+
+
+
domain entity does not exist - http://purl.obolibrary.org/obo/OMO_0001002
+
+
+
+
+
+
+
dubious synonym - http://purl.obolibrary.org/obo/OMO_0003002
+
+
+
+
+
+
+
dynamic nuclear polarization NMR - http://nmrML.org/nmrCV#NMR:1000222
+
+
+
+
+
+
+
+
+
+
editor note - http://purl.obolibrary.org/obo/IAO_0000116
+
+
+
+
+
+
+
editor preferred term - http://purl.obolibrary.org/obo/IAO_0000111
+
+
+
+
+
+
+
editors ontology module - http://purl.obolibrary.org/obo/IAO_8000002
+
+
+
+
+
+
+
elemental molecular entity - http://purl.obolibrary.org/obo/CHEBI_33259
+
+
+
+
+
+
+
elucidation - http://purl.obolibrary.org/obo/IAO_0000600
+
+
+
+
+
+
+
entity - http://nmrML.org/nmrCV#BFO_0000001
+
+
+
+
+
+
+
entity - http://purl.obolibrary.org/obo/BFO_0000001
+
+
+
+
+ - entity elucidation "An entity is anything that exists or has existed or will exist. (axiom label in BFO2 Reference: [001-001])"@en
+- entity editor note "BFO 2 Reference: In all areas of empirical inquiry we encounter general terms of two sorts. First are general terms which refer to universals or types:animaltuberculosissurgical procedurediseaseSecond, are general terms used to refer to groups of entities which instantiate a given universal but do not correspond to the extension of any subuniversal of that universal because there is nothing intrinsic to the entities in question by virtue of which they – and only they – are counted as belonging to the given group. Examples are: animal purchased by the Emperortuberculosis diagnosed on a Wednesdaysurgical procedure performed on a patient from Stockholmperson identified as candidate for clinical trial #2056-555person who is signatory of Form 656-PPVpainting by Leonardo da VinciSuch terms, which represent what are called ‘specializations’ in [81"@en
+- entity example of usage "Verdi’s Requiem"@en
+- entity BFO OWL specification label "entity"
+- entity example of usage "your body mass index"@en
+- entity example of usage "Julius Caesar"@en
+- entity editor note "Entity doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. For example Werner Ceusters 'portions of reality' include 4 sorts, entities (as BFO construes them), universals, configurations, and relations. It is an open question as to whether entities as construed in BFO will at some point also include these other portions of reality. See, for example, 'How to track absolutely everything' at http://www.referent-tracking.com/_RTU/papers/CeustersICbookRevised.pdf"@en
+- entity BFO CLIF specification label "Entity"
+- entity isDefinedBy bfo.owl
+- entity label "entity"@en
+- entity example of usage "the Second World War"@en
+- Class: entity
+- entity SubClassOf Thing
+
+
+
+
ethanol-d6 - http://purl.obolibrary.org/obo/CHEBI_193043
+
+
+
+
+
+
+
example of usage - http://purl.obolibrary.org/obo/IAO_0000112
+
+
+
+
+
+
+
example to be eventually removed - http://purl.obolibrary.org/obo/IAO_0000002
+
+
+
+
+
+
+
exclusion subset ontology module - http://purl.obolibrary.org/obo/IAO_8000010
+
+
+
+
+
+
+
expand assertion to - http://purl.obolibrary.org/obo/IAO_0000425
+
+
+
+
+
+
+
expand expression to - http://purl.obolibrary.org/obo/IAO_0000424
+
+
+
+
+
+
+
external import ontology module - http://purl.obolibrary.org/obo/IAO_8000011
+
+
+
+
+
+
+
failed exploratory term - http://purl.obolibrary.org/obo/IAO_0000103
+
+
+
+
+
+
+
fiat object part - http://purl.obolibrary.org/obo/BFO_0000024
+
+
+
+
+ - fiat object part isDefinedBy bfo.owl
+- fiat object part example of usage "the division of the brain into regions"@en
+- fiat object part BFO OWL specification label "fiat-object-part"
+- fiat object part example of usage "the Western hemisphere of the Earth"@en
+- fiat object part example of usage "the division of the planet into hemispheres"@en
+- fiat object part label "fiat object part"@en
+- fiat object part editor note "BFO 2 Reference: Most examples of fiat object parts are associated with theoretically drawn divisions"@en
+- fiat object part example of usage "the dorsal and ventral surfaces of the body"@en
+- fiat object part BFO CLIF specification label "FiatObjectPart"
+- fiat object part example of usage "the FMA:regional parts of an intact human body."@en
+- fiat object part elucidation "b is a fiat object part = Def. b is a material entity which is such that for all times t, if b exists at t then there is some object c such that b proper continuant_part of c at t and c is demarcated from the remainder of c by a two-dimensional continuant fiat boundary. (axiom label in BFO2 Reference: [027-004])"@en
+- fiat object part example of usage "or with divisions drawn by cognitive subjects for practical reasons, such as the division of a cake (before slicing) into (what will become) slices (and thus member parts of an object aggregate). However, this does not mean that fiat object parts are dependent for their existence on divisions or delineations effected by cognitive subjects. If, for example, it is correct to conceive geological layers of the Earth as fiat object parts of the Earth, then even though these layers were first delineated in recent times, still existed long before such delineation and what holds of these layers (for example that the oldest layers are also the lowest layers) did not begin to hold because of our acts of delineation.Treatment of material entity in BFOExamples viewed by some as problematic cases for the trichotomy of fiat object part, object, and object aggregate include: a mussel on (and attached to) a rock, a slime mold, a pizza, a cloud, a galaxy, a railway train with engine and multiple carriages, a clonal stand of quaking aspen, a bacterial community (biofilm), a broken femur. Note that, as Aristotle already clearly recognized, such problematic cases – which lie at or near the penumbra of instances defined by the categories in question – need not invalidate these categories. The existence of grey objects does not prove that there are not objects which are black and objects which are white; the existence of mules does not prove that there are not objects which are donkeys and objects which are horses. It does, however, show that the examples in question need to be addressed carefully in order to show how they can be fitted into the proposed scheme, for example by recognizing additional subdivisions [29"@en
+- fiat object part has associated axiom(fol) "(forall (x) (if (FiatObjectPart x) (and (MaterialEntity x) (forall (t) (if (existsAt x t) (exists (y) (and (Object y) (properContinuantPartOfAt x y t)))))))) // axiom label in BFO2 CLIF: [027-004] "
+- fiat object part example of usage "the upper and lower lobes of the left lung"@en
+- Class: fiat object part
+- fiat object part SubClassOf material entity
+
+
+
+
first order logic expression - http://purl.obolibrary.org/obo/IAO_0000426
+
+
+
+
+
+
+
fluorine-19 atom - http://purl.obolibrary.org/obo/CHEBI_36940
+
+
+
+
+
+
+
fluorosulfonic acid - http://purl.obolibrary.org/obo/CHEBI_193136
+
+
+
+
+
+
+
format - http://purl.org/dc/elements/1.1/format
+
+
+
+
+ - AnnotationProperty: format
+
+
+
+
formic acid-d2 - http://purl.obolibrary.org/obo/CHEBI_193132
+
+
+
+
+
+
+
formula - http://purl.obolibrary.org/obo/chebi/formula
+
+
+
+
+
+
+
fourier transformation NMR instrument - http://nmrML.org/nmrCV#NMR:1400284
+
+
+
+
+
+
+
+
+
+
function - http://purl.obolibrary.org/obo/BFO_0000034
+
+
+
+
+ - function elucidation "A function is a disposition that exists in virtue of the bearer’s physical make-up and this physical make-up is something the bearer possesses because it came into being, either through evolution (in the case of natural biological entities) or through intentional design (in the case of artifacts), in order to realize processes of a certain sort. (axiom label in BFO2 Reference: [064-001])"@en
+- function BFO OWL specification label "function"
+- function BFO CLIF specification label "Function"
+- function isDefinedBy bfo.owl
+- function label "function"@en
+- function example of usage "the function of a hammer to drive in nails"@en
+- function editor note "BFO 2 Reference: In the past, we have distinguished two varieties of function, artifactual function and biological function. These are not asserted subtypes of BFO:function however, since the same function – for example: to pump, to transport – can exist both in artifacts and in biological entities. The asserted subtypes of function that would be needed in order to yield a separate monoheirarchy are not artifactual function, biological function, etc., but rather transporting function, pumping function, etc."@en
+- function example of usage "the function of a heart pacemaker to regulate the beating of a heart through electricity"@en
+- function example of usage "the function of amylase in saliva to break down starch into sugar"@en
+- function has associated axiom(fol) "(forall (x) (if (Function x) (Disposition x))) // axiom label in BFO2 CLIF: [064-001] "
+- Class: function
+- function SubClassOf disposition
+
+
+
+
function of - http://purl.obolibrary.org/obo/RO_0000079
+
+
+
+
+
+
+
gallium nitrate - http://purl.obolibrary.org/obo/CHEBI_231505
+
+
+
+
+
+
+
generated ontology module - http://purl.obolibrary.org/obo/IAO_8000014
+
+
+
+
+
+
+
generically dependent continuant - http://purl.obolibrary.org/obo/BFO_0000031
+
+
+
+
+
+
+
+
+
+
generically depends on - http://purl.obolibrary.org/obo/RO_0010001
+
+
+
+
+
+
+
germanium-73 atom - http://purl.obolibrary.org/obo/CHEBI_52758
+
+
+
+
+
+
+
has ID digit count - http://purl.obolibrary.org/obo/IAO_0000596
+
+
+
+
+
+
+
has ID policy for - http://purl.obolibrary.org/obo/IAO_0000598
+
+
+
+
+
+
+
has ID prefix - http://purl.obolibrary.org/obo/IAO_0000599
+
+
+
+
+
+
+
has ID range allocated to - http://purl.obolibrary.org/obo/IAO_0000597
+
+
+
+
+
+
+
has associated axiom(fol) - http://purl.obolibrary.org/obo/IAO_0000602
+
+
+
+
+
+
+
has associated axiom(nl) - http://purl.obolibrary.org/obo/IAO_0000601
+
+
+
+
+
+
+
has axiom label - http://purl.obolibrary.org/obo/IAO_0010000
+
+
+
+
+
+
+
has broad synonym - http://www.geneontology.org/formats/oboInOwl#hasBroadSynonym
+
+
+
+
+
+
+
has characteristic - http://purl.obolibrary.org/obo/RO_0000053
+
+
+
+
+
+
+
has curation status - http://purl.obolibrary.org/obo/IAO_0000114
+
+
+
+
+
+
+
has disposition - http://purl.obolibrary.org/obo/RO_0000091
+
+
+
+
+
+
+
has function - http://purl.obolibrary.org/obo/RO_0000085
+
+
+
+
+
+
+
has member - http://purl.obolibrary.org/obo/RO_0002351
+
+
+
+
+
+
+
has narrow synonym - http://www.geneontology.org/formats/oboInOwl#hasNarrowSynonym
+
+
+
+
+
+
+
has obsolescence reason - http://purl.obolibrary.org/obo/IAO_0000231
+
+
+
+
+
+
+
has ontology root term - http://purl.obolibrary.org/obo/IAO_0000700
+
+
+
+
+
+
+
has part - http://purl.obolibrary.org/obo/BFO_0000051
+
+
+
+
+
+
+
has participant - http://purl.obolibrary.org/obo/RO_0000057
+
+
+
+
+
+
+
has quality - http://purl.obolibrary.org/obo/RO_0000086
+
+
+
+
+
+
+
has related synonym - http://www.geneontology.org/formats/oboInOwl#hasRelatedSynonym
+
+
+
+
+
+
+
has role - http://purl.obolibrary.org/obo/RO_0000087
+
+
+
+
+
+
+
has specified input - http://purl.obolibrary.org/obo/OBI_0000293
+
+
+
+
+
+
+
has specified output - http://purl.obolibrary.org/obo/OBI_0000299
+
+
+
+
+
+
+
has symbol - http://purl.obolibrary.org/obo/OMO_0004000
+
+
+
+
+
+
+
has value specification - http://purl.obolibrary.org/obo/OBI_0001938
+
+
+
+
+
+
+
hasAlternativeId - http://www.geneontology.org/formats/oboInOwl#hasAlternativeId
+
+
+
+
+
+
+
hasSynonymType - http://www.geneontology.org/formats/oboInOwl#hasSynonymType
+
+
+
+
+
+
+
has_exact_synonym - http://www.geneontology.org/formats/oboInOwl#hasExactSynonym
+
+
+
+
+
+
+
heavy water - http://nmrML.org/nmrCV#NMR:1000018
+
+
+
+
+
+
+
+
+
+
helium(0) - http://purl.obolibrary.org/obo/CHEBI_33681
+
+
+
+
+
+
+
helium-3 atom - http://purl.obolibrary.org/obo/CHEBI_30218
+
+
+
+
+
+
+
hexafluoroacetone - http://purl.obolibrary.org/obo/CHEBI_39429
+
+
+
+
+ - hexafluoroacetone mass "166.02192"
+- hexafluoroacetone database_cross_reference "CAS:684-16-2"
- source "NIST Chemistry WebBook"
+- hexafluoroacetone has related synonym "perfluoro-2-propanone"
+- hexafluoroacetone database_cross_reference "PMID:22481381"
+- hexafluoroacetone definition "A ketone that is acetone in which all the methyl hydrogens are replaced by fluoro groups."
+- hexafluoroacetone database_cross_reference "CAS:684-16-2"
+- hexafluoroacetone monoisotopicmass "165.98533"
+- hexafluoroacetone has_exact_synonym "1,1,1,3,3,3-hexafluoroacetone"
+- hexafluoroacetone has related synonym "6FK"
+- hexafluoroacetone smiles "FC(F)(F)C(=O)C(F)(F)F"
+- hexafluoroacetone charge "0"
+- hexafluoroacetone label "hexafluoroacetone"
+- hexafluoroacetone has related synonym "perfluoroacetone"
+- hexafluoroacetone inchikey "VBZWSGALLODQNC-UHFFFAOYSA-N"
+- hexafluoroacetone database_cross_reference "Patent:CN102964231"
+- hexafluoroacetone has related synonym "1,1,1,3,3,3-hexafluoro-2-propanone"
+- hexafluoroacetone database_cross_reference "Wikipedia:Hexafluoroacetone"
+- hexafluoroacetone inchi "InChI=1S/C3F6O/c4-2(5,6)1(10)3(7,8)9"
+- hexafluoroacetone database_cross_reference "Reaxys:607236"
+- hexafluoroacetone database_cross_reference "PMID:24186328"
+- hexafluoroacetone id "CHEBI:39429"
+- hexafluoroacetone has related synonym "(CF3)2CO"
+- hexafluoroacetone formula "C3F6O"
+- hexafluoroacetone database_cross_reference "Gmelin:27263"
+- hexafluoroacetone has_obo_namespace "chebi_ontology"
+- hexafluoroacetone database_cross_reference "Patent:CN102976908"
+- hexafluoroacetone has related synonym "hexafluoropropanone"
+- hexafluoroacetone inSubset _STAR
+- Class: hexafluoroacetone
+- hexafluoroacetone SubClassOf polyatomic entity
+- hexafluoroacetone SubClassOf main group molecular entity
+
+
+
+
hexafluorobenzene - http://purl.obolibrary.org/obo/CHEBI_38589
+
+
+
+
+
+
+
history - http://purl.obolibrary.org/obo/BFO_0000182
+
+
+
+
+
+
+
hydrogen fluoride - http://purl.obolibrary.org/obo/CHEBI_29228
+
+
+
+
+
+
+
identifier - http://purl.org/dc/terms/identifier
+
+
+
+
+
+
+
identifier - http://purl.org/dc/elements/1.1/identifier
+
+
+
+
+
+
+
immaterial entity - http://purl.obolibrary.org/obo/BFO_0000141
+
+
+
+
+
+
+
implements - http://usefulinc.com/ns/doap#implements
+
+
+
+
+
+
+
import ontology module - http://purl.obolibrary.org/obo/IAO_8000005
+
+
+
+
+
+
+
imported from - http://purl.obolibrary.org/obo/IAO_0000412
+
+
+
+
+
+
+
in branch - http://purl.obolibrary.org/obo/IAO_0000113
+
+
+
+
+
+
+
inSubset - http://www.geneontology.org/formats/oboInOwl#inSubset
+
+
+
+
+
+
+
inchi - http://purl.obolibrary.org/obo/chebi/inchi
+
+
+
+
+ - AnnotationProperty: inchi
+
+
+
+
inchikey - http://purl.obolibrary.org/obo/chebi/inchikey
+
+
+
+
+
+
+
independent continuant - http://purl.obolibrary.org/obo/BFO_0000004
+
+
+
+
+
+
+
indium(III) nitrate - http://purl.obolibrary.org/obo/CHEBI_231512
+
+
+
+
+
+
+
information content entity - http://purl.obolibrary.org/obo/IAO_0000030
+
+
+
+
+
+
+
information processor function - http://purl.obolibrary.org/obo/OBI_0000392
+
+
+
+
+
+
+
inorganic molecular entity - http://purl.obolibrary.org/obo/CHEBI_24835
+
+
+
+
+
+
+
instrument - http://nmrML.org/nmrCV#NMR:1000463
+
+
+
+
+
+
+
+
+
+
iodine-127 atom - http://purl.obolibrary.org/obo/CHEBI_52631
+
+
+
+
+
+
+
ion - http://purl.obolibrary.org/obo/CHEBI_24870
+
+
+
+
+
+
+
iron-57 atom - http://purl.obolibrary.org/obo/CHEBI_52623
+
+
+
+
+
+
+
is a defining property chain axiom where second argument is reflexive - http://purl.obolibrary.org/obo/RO_0002582
+
+
+
+
+
+
+
is about - http://purl.obolibrary.org/obo/IAO_0000136
+
+
+
+
+ - is about term editor "person:Alan Ruttenberg"@en
+- is about has curation status pending final vetting
+- is about definition "A (currently) primitive relation that relates an information artifact to an entity."@en
+- is about definition source "Smith, Ceusters, Ruttenberg, 2000 years of philosophy"@en
+- is about editor note "7/6/2009 Alan Ruttenberg. Following discussion with Jonathan Rees, and introduction of "mentions" relation. Weaken the is_about relationship to be primitive.
+
+We will try to build it back up by elaborating the various subproperties that are more precisely defined.
+
+Some currently missing phenomena that should be considered "about" are predications - "The only person who knows the answer is sitting beside me" , Allegory, Satire, and other literary forms that can be topical without explicitly mentioning the topic."@en
+- is about label "is about"@en
+- is about example of usage "This document is about information artifacts and their representations"@en
+- ObjectProperty: is about
+- is about Domain information content entity
+
+
+
+
is allocated id range - http://purl.obolibrary.org/obo/IAO_0000603
+
+
+
+
+
+
+
is carrier of - http://purl.obolibrary.org/obo/RO_0010002
+
+
+
+
+
+
+
is concretized as - http://purl.obolibrary.org/obo/RO_0000058
+
+
+
+
+ - is concretized as definition "A relationship between a generically dependent continuant and a specifically dependent continuant, in which the generically dependent continuant depends on some independent continuant in virtue of the fact that the specifically dependent continuant also depends on that same independent continuant. A generically dependent continuant may be concretized as multiple specifically dependent continuants."@en
+- is concretized as definition "A relationship between a generically dependent continuant and a specifically dependent continuant or process, in which the generically dependent continuant depends on some independent continuant or process in virtue of the fact that the specifically dependent continuant or process also depends on that same independent continuant. A generically dependent continuant may be concretized as multiple specifically dependent continuants or processes."@en
+- is concretized as example of usage "A journal article is an information artifact that inheres in some number of printed journals. For each copy of the printed journal there is some quality that carries the journal article, such as a pattern of ink. The journal article (a generically dependent continuant) is concretized as the quality (a specifically dependent continuant), and both depend on that copy of the printed journal (an independent continuant)."@en
+- is concretized as example of usage "An investigator reads a protocol and forms a plan to carry out an assay. The plan is a realizable entity (a specifically dependent continuant) that concretizes the protocol (a generically dependent continuant), and both depend on the investigator (an independent continuant). The plan is then realized by the assay (a process)."@en
+- is concretized as label "is concretized as"@en
+- ObjectProperty: is concretized as
+- is concretized as InverseOf concretizes
+- is concretized as Domain generically dependent continuant
+- is concretized as Range specifically dependent continuant
+- is concretized as Range process or specifically dependent continuant
+
+
+
+
is denotator type - http://purl.obolibrary.org/obo/IAO_0000411
+
+
+
+
+
+
+
is specified input of - http://purl.obolibrary.org/obo/OBI_0000295
+
+
+
+
+
+
+
is specified output of - http://purl.obolibrary.org/obo/OBI_0000312
+
+
+
+
+
+
+
isDefinedBy - http://www.w3.org/2000/01/rdf-schema#isDefinedBy
+
+
+
+
+
+
+
is_cyclic - http://www.geneontology.org/formats/oboInOwl#is_cyclic
+
+
+
+
+
+
+
is_inferred - http://www.geneontology.org/formats/oboInOwl#is_inferred
+
+
+
+
+
+
+
is_manufactured_by - http://purl.obolibrary.org/obo/OBI_0000304
+
+
+
+
+
+
+
is_transitive - http://www.geneontology.org/formats/oboInOwl#is_transitive
+
+
+
+
+
+
+
isotopically modified compound - http://purl.obolibrary.org/obo/CHEBI_139358
+
+
+
+
+
+
+
krypton atom - http://purl.obolibrary.org/obo/CHEBI_49696
+
+
+
+
+
+
+
language - http://purl.org/dc/elements/1.1/language
+
+
+
+
+
+
+
lanthanum trichloride - http://purl.obolibrary.org/obo/CHEBI_231515
+
+
+
+
+
+
+
lanthanum-139 atom - http://purl.obolibrary.org/obo/CHEBI_52627
+
+
+
+
+
+
+
latin term - http://purl.obolibrary.org/obo/OMO_0003011
+
+
+
+
+
+
+
layperson synonym - http://purl.obolibrary.org/obo/OMO_0003003
+
+
+
+
+
+
+
legal name - http://purl.obolibrary.org/obo/OMO_0003009
+
+
+
+
+
+
+
license - http://purl.org/dc/terms/license
+
+
+
+
+
+
+
line broadening - http://nmrML.org/nmrCV#NMR:1400097
+
+
+
+ - line broadening definition "line broadening is a process resulting in spectral peak signal becoming hard to interpret and analysed. Line broadening is affected by spin-spin relaxation and/or spin-lattice relaxation processes.
+When relaxation is very fast, NMR lines are broad, J-coupling may not be resolved or the signal may even be difficult or impossible to detect.
+The maximum repetition rate during acquisition of an NMR signal is governed by T1 - short T1 means the magnetization recovers more rapidly, and a spectrum can be acquired in less time.
+Line broadening may be caused by:
+Sample inhomogeneity (poor mixing. solid particles), Temperature gradients across sample, Paramagnetic impurities."
+
+
+
+
+
+ - line broadening definition "line broadening is a process resulting in spectral peak signal becoming hard to interpret and analysed. Line broadening is affected by spin-spin relaxation and/or spin-lattice relaxation processes.
+When relaxation is very fast, NMR lines are broad, J-coupling may not be resolved or the signal may even be difficult or impossible to detect.
+The maximum repetition rate during acquisition of an NMR signal is governed by T1 - short T1 means the magnetization recovers more rapidly, and a spectrum can be acquired in less time.
+Line broadening may be caused by:
+Sample inhomogeneity (poor mixing. solid particles), Temperature gradients across sample, Paramagnetic impurities."
+
+
+
+
liquid chromatography NMR - http://nmrML.org/nmrCV#NMR:1400276
+
+
+
+
+
+
+
+
+
+
lithium chloride - http://purl.obolibrary.org/obo/CHEBI_48607
+
+
+
+
+
+
+
lithium-6 atom - http://purl.obolibrary.org/obo/CHEBI_52621
+
+
+
+
+
+
+
lithium-7 atom - http://purl.obolibrary.org/obo/CHEBI_52458
+
+
+
+
+
+
+
location - http://usefulinc.com/ns/doap#location
+
+
+
+
+
+
+
logical characteristic of object property - http://purl.obolibrary.org/obo/OMO_0001001
+
+
+
+
+
+
+
magnesium dichloride - http://purl.obolibrary.org/obo/CHEBI_6636
+
+
+
+
+
+
+
magnesium-25 atom - http://purl.obolibrary.org/obo/CHEBI_52763
+
+
+
+
+
+
+
mailing-list - http://usefulinc.com/ns/doap#mailing-list
+
+
+
+
+
+
+
main group molecular entity - http://purl.obolibrary.org/obo/CHEBI_33579
+
+
+
+
+
+
+
main release ontology module - http://purl.obolibrary.org/obo/IAO_8000003
+
+
+
+
+
+
+
maintainer - http://usefulinc.com/ns/doap#maintainer
+
+
+
+
+
+
+
mancude ring - http://purl.obolibrary.org/obo/CHEBI_35568
+
+
+
+
+
+
+
manganese-55 atom - http://purl.obolibrary.org/obo/CHEBI_176583
+
+
+
+
+
+
+
manufacturer - http://purl.obolibrary.org/obo/OBI_0000835
+
+
+
+
+
+
+
manufacturer role - http://purl.obolibrary.org/obo/OBI_0000571
+
+
+
+
+
+
+
manufacturing - http://purl.obolibrary.org/obo/OBI_0000457
+
+
+
+
+
+
+
mass - http://purl.obolibrary.org/obo/chebi/mass
+
+
+
+
+ - AnnotationProperty: mass
+
+
+
+
material entity - http://purl.obolibrary.org/obo/BFO_0000040
+
+
+
+
+ - material entity isDefinedBy bfo.owl
+- material entity example of usage "a hurricane"@en
+- material entity has associated axiom(fol) "(forall (x) (if (and (Entity x) (exists (y t) (and (MaterialEntity y) (continuantPartOfAt x y t)))) (MaterialEntity x))) // axiom label in BFO2 CLIF: [021-002] "
+- material entity has associated axiom(fol) "(forall (x) (if (and (Entity x) (exists (y t) (and (MaterialEntity y) (continuantPartOfAt y x t)))) (MaterialEntity x))) // axiom label in BFO2 CLIF: [020-002] "
+- material entity example of usage "a puff of smoke"@en
+- material entity example of usage "an aggregate of human beings."@en
+- material entity BFO OWL specification label "material"
+- material entity example of usage "an energy wave"@en
+- material entity has associated axiom(nl) "every entity of which a material entity is continuant part is also a material entity. (axiom label in BFO2 Reference: [021-002])"@en
+- material entity editor note "BFO 2 Reference: ‘Matter’ is intended to encompass both mass and energy (we will address the ontological treatment of portions of energy in a later version of BFO). A portion of matter is anything that includes elementary particles among its proper or improper parts: quarks and leptons, including electrons, as the smallest particles thus far discovered; baryons (including protons and neutrons) at a higher level of granularity; atoms and molecules at still higher levels, forming the cells, organs, organisms and other material entities studied by biologists, the portions of rock studied by geologists, the fossils studied by paleontologists, and so on.Material entities are three-dimensional entities (entities extended in three spatial dimensions), as contrasted with the processes in which they participate, which are four-dimensional entities (entities extended also along the dimension of time).According to the FMA, material entities may have immaterial entities as parts – including the entities identified below as sites; for example the interior (or ‘lumen’) of your small intestine is a part of your body. BFO 2.0 embodies a decision to follow the FMA here."@en
+- material entity example of usage "a photon"@en
+- material entity definition "An independent continuant that is spatially extended whose identity is independent of that of other entities and can be maintained through time."@en
+- material entity has associated axiom(fol) "(forall (x) (if (MaterialEntity x) (IndependentContinuant x))) // axiom label in BFO2 CLIF: [019-002] "
+- material entity has associated axiom(nl) "Every entity which has a material entity as continuant part is a material entity. (axiom label in BFO2 Reference: [020-002])"@en
+- material entity editor preferred term "material entity"@en
+- material entity BFO CLIF specification label "MaterialEntity"
+- material entity example of usage "an epidemic"@en
+- material entity editor note "BFO 2 Reference: Object, Fiat Object Part and Object Aggregate are not intended to be exhaustive of Material Entity. Users are invited to propose new subcategories of Material Entity."@en
+- material entity example of usage "the undetached arm of a human being"@en
+- material entity example of usage "a tornado"@en
+- material entity imported from ido.owl
+- material entity example of usage "a flame"@en
+- material entity example of usage "a sea wave"@en
+- material entity elucidation "A material entity is an independent continuant that has some portion of matter as proper or improper continuant part. (axiom label in BFO2 Reference: [019-002])"@en
+- material entity example of usage "a human being"@en
+- material entity editor note "BFO 2 Reference: Material entities (continuants) can preserve their identity even while gaining and losing material parts. Continuants are contrasted with occurrents, which unfold themselves in successive temporal parts or phases [60"@en
+- material entity example of usage "a forest fire"@en
+- material entity label "material entity"@en
+- Class: material entity
+- material entity DisjointWith immaterial entity
+- material entity SubClassOf independent continuant
+
+
+
+
material processing - http://purl.obolibrary.org/obo/OBI_0000094
+
+
+
+
+
+
+
may be identical to - http://purl.obolibrary.org/obo/IAO_0006011
+
+
+
+
+
+
+
mbox - http://xmlns.com/foaf/0.1/mbox
+
+
+
+
+ - AnnotationProperty: mbox
+
+
+
+
measure function - http://purl.obolibrary.org/obo/OBI_0000453
+
+
+
+
+
+
+
measurement device - http://purl.obolibrary.org/obo/OBI_0000832
+
+
+
+
+
+
+
member - http://purl.org/dc/elements/1.1/member
+
+
+
+
+ - AnnotationProperty: member
+
+
+
+
member of - http://purl.obolibrary.org/obo/RO_0002350
+
+
+
+
+
+
+
mereotopologically related to - http://purl.obolibrary.org/obo/RO_0002323
+
+
+
+
+
+
+
metadata complete - http://purl.obolibrary.org/obo/IAO_0000120
+
+
+
+
+
+
+
metadata incomplete - http://purl.obolibrary.org/obo/IAO_0000123
+
+
+
+
+
+
+
methanol-d1 - http://purl.obolibrary.org/obo/CHEBI_193133
+
+
+
+
+
+
+
methanol-d4 - http://purl.obolibrary.org/obo/CHEBI_156265
+
+
+
+
+
+
+
micromass - http://nmrML.org/nmrCV#NMR:1400310
+
+
+
+
+
+
+
+
+
+
misnomer - http://purl.obolibrary.org/obo/OMO_0003007
+
+
+
+
+
+
+
misspelling - http://purl.obolibrary.org/obo/OMO_0003006
+
+
+
+
+
+
+
molecular entity - http://purl.obolibrary.org/obo/CHEBI_23367
+
+
+
+
+
+
+
molecule - http://nmrML.org/nmrCV#NMR:1000859
+
+
+
+
+
+
+
+
+
+
molybdenum-95 - http://purl.obolibrary.org/obo/CHEBI_52633
+
+
+
+
+
+
+
monofluorobenzene - http://purl.obolibrary.org/obo/CHEBI_5115
+
+
+
+
+
+
+
monoisotopicmass - http://purl.obolibrary.org/obo/chebi/monoisotopicmass
+
+
+
+
+
+
+
morpholine - http://purl.obolibrary.org/obo/CHEBI_34856
+
+
+
+
+
+
+
named class expression - http://purl.obolibrary.org/obo/IAO_0000421
+
+
+
+
+
+
+
neon atom - http://purl.obolibrary.org/obo/CHEBI_33310
+
+
+
+
+
+
+
niobium-93 atom - http://purl.obolibrary.org/obo/CHEBI_52460
+
+
+
+
+
+
+
nitrobenzene-d5 - http://purl.obolibrary.org/obo/CHEBI_193044
+
+
+
+
+
+
+
nitrogen-14 atom - http://purl.obolibrary.org/obo/CHEBI_36938
+
+
+
+
+
+
+
nitrogen-15 atom - http://purl.obolibrary.org/obo/CHEBI_36934
+
+
+
+
+
+
+
nitromethane - http://purl.obolibrary.org/obo/CHEBI_77701
+
+
+
+
+
+
+
nitromethane - http://nmrML.org/nmrCV#NMR:1000040
+
+
+
+
+
+
+
+
+
+
nitromethane-d3 - http://purl.obolibrary.org/obo/CHEBI_193045
+
+
+
+
+
+
+
object - http://purl.obolibrary.org/obo/BFO_0000030
+
+
+
+
+
+
+
+ - object editor note "BFO 2 Reference: BFO rests on the presupposition that at multiple micro-, meso- and macroscopic scales reality exhibits certain stable, spatially separated or separable material units, combined or combinable into aggregates of various sorts (for example organisms into what are called ‘populations’). Such units play a central role in almost all domains of natural science from particle physics to cosmology. Many scientific laws govern the units in question, employing general terms (such as ‘molecule’ or ‘planet’) referring to the types and subtypes of units, and also to the types and subtypes of the processes through which such units develop and interact. The division of reality into such natural units is at the heart of biological science, as also is the fact that these units may form higher-level units (as cells form multicellular organisms) and that they may also form aggregates of units, for example as cells form portions of tissue and organs form families, herds, breeds, species, and so on. At the same time, the division of certain portions of reality into engineered units (manufactured artifacts) is the basis of modern industrial technology, which rests on the distributed mass production of engineered parts through division of labor and on their assembly into larger, compound units such as cars and laptops. The division of portions of reality into units is one starting point for the phenomenon of counting."@en
+- object example of usage "engineered artifacts"@en
+- object example of usage "star"@en
+- object editor note "BFO 2 Reference: ‘objects’ are sometimes referred to as ‘grains’ [74"@en
+- object BFO OWL specification label "object"
+- object label "object"@en
+- object editor note "BFO 2 Reference: To say that b is causally unified means: b is a material entity which is such that its material parts are tied together in such a way that, in environments typical for entities of the type in question,if c, a continuant part of b that is in the interior of b at t, is larger than a certain threshold size (which will be determined differently from case to case, depending on factors such as porosity of external cover) and is moved in space to be at t at a location on the exterior of the spatial region that had been occupied by b at t, then either b’s other parts will be moved in coordinated fashion or b will be damaged (be affected, for example, by breakage or tearing) in the interval between t and t.causal changes in one part of b can have consequences for other parts of b without the mediation of any entity that lies on the exterior of b. Material entities with no proper material parts would satisfy these conditions trivially. Candidate examples of types of causal unity for material entities of more complex sorts are as follows (this is not intended to be an exhaustive list):CU1: Causal unity via physical coveringHere the parts in the interior of the unified entity are combined together causally through a common membrane or other physical covering\. The latter points outwards toward and may serve a protective function in relation to what lies on the exterior of the entity [13, 47"@en
+- object example of usage "molecule"@en
+- object example of usage "atom"@en
+- object example of usage "cells and organisms"@en
+- object editor note "BFO 2 Reference: Each object is such that there are entities of which we can assert unproblematically that they lie in its interior, and other entities of which we can assert unproblematically that they lie in its exterior. This may not be so for entities lying at or near the boundary between the interior and exterior. This means that two objects – for example the two cells depicted in Figure 3 – may be such that there are material entities crossing their boundaries which belong determinately to neither cell. Something similar obtains in certain cases of conjoined twins (see below)."@en
+- object example of usage "cell"@en
+- object example of usage "organelle"@en
+- object isDefinedBy bfo.owl
+- object example of usage "organism"@en
+- object example of usage "planet"@en
+- object elucidation "b is an object means: b is a material entity which manifests causal unity of one or other of the types CUn listed above & is of a type (a material universal) instances of which are maximal relative to this criterion of causal unity. (axiom label in BFO2 Reference: [024-001])"@en
+- object BFO CLIF specification label "Object"
+- object example of usage "grain of sand"@en
+- object editor note "BFO 2 Reference: an object is a maximal causally unified material entity"@en
+- object example of usage "solid portions of matter"@en
+- object SubClassOf material entity
+
+
+
+
object aggregate - http://purl.obolibrary.org/obo/BFO_0000027
+
+
+
+
+
+
+
objective specification - http://purl.obolibrary.org/obo/IAO_0000005
+
+
+
+
+
+
+
objective_achieved_by - http://purl.obolibrary.org/obo/OBI_0000833
+
+
+
+
+
+
+
obo basic subset ontology module - http://purl.obolibrary.org/obo/IAO_8000018
+
+
+
+
+
+
+
obsolescence reason specification - http://purl.obolibrary.org/obo/IAO_0000225
+
+
+
+
+
+
+
obsolete_core - http://purl.obolibrary.org/obo/IAO_0000224
+
+
+
+
+
+
+
occurrent - http://purl.obolibrary.org/obo/BFO_0000003
+
+
+
+
+ - occurrent has associated axiom(fol) "(forall (x) (iff (Occurrent x) (and (Entity x) (exists (y) (temporalPartOf y x))))) // axiom label in BFO2 CLIF: [079-001] "
+- occurrent has associated axiom(fol) "(forall (x) (if (Occurrent x) (exists (r) (and (SpatioTemporalRegion r) (occupiesSpatioTemporalRegion x r))))) // axiom label in BFO2 CLIF: [108-001] "
+- occurrent has associated axiom(nl) "Every occurrent occupies_spatiotemporal_region some spatiotemporal region. (axiom label in BFO2 Reference: [108-001])"@en
+- occurrent editor note "BFO 2 Reference: s-dependence obtains between every process and its participants in the sense that, as a matter of necessity, this process could not have existed unless these or those participants existed also. A process may have a succession of participants at different phases of its unfolding. Thus there may be different players on the field at different times during the course of a football game; but the process which is the entire game s-depends_on all of these players nonetheless. Some temporal parts of this process will s-depend_on on only some of the players."@en
+- occurrent BFO OWL specification label "occurrent"
+- occurrent elucidation "An occurrent is an entity that unfolds itself in time or it is the instantaneous boundary of such an entity (for example a beginning or an ending) or it is a temporal or spatiotemporal region which such an entity occupies_temporal_region or occupies_spatiotemporal_region. (axiom label in BFO2 Reference: [077-002])"@en
+- occurrent BFO CLIF specification label "Occurrent"
+- occurrent editor note "Simons uses different terminology for relations of occurrents to regions: Denote the spatio-temporal location of a given occurrent e by 'spn[e]' and call this region its span. We may say an occurrent is at its span, in any larger region, and covers any smaller region. Now suppose we have fixed a frame of reference so that we can speak not merely of spatio-temporal but also of spatial regions (places) and temporal regions (times). The spread of an occurrent, (relative to a frame of reference) is the space it exactly occupies, and its spell is likewise the time it exactly occupies. We write 'spr[e]' and `spl[e]' respectively for the spread and spell of e, omitting mention of the frame."
+- occurrent isDefinedBy bfo.owl
+- occurrent label "occurrent"@en
+- occurrent editor note "BFO 2 Reference: every occurrent that is not a temporal or spatiotemporal region is s-dependent on some independent continuant that is not a spatial region"@en
+- occurrent definition "An entity that has temporal parts and that happens, unfolds or develops through time."@en
+- occurrent editor note "Occurrent doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. An example would be the sum of a process and the process boundary of another process."@en
+- occurrent has associated axiom(nl) "b is an occurrent entity iff b is an entity that has temporal parts. (axiom label in BFO2 Reference: [079-001])"@en
+- Class: occurrent
+- occurrent DisjointWith part of some continuant
+- occurrent SubClassOf entity
+
+
+
+
one-dimensional continuant fiat boundary - http://purl.obolibrary.org/obo/BFO_0000142
+
+
+
+
+
+
+
one-dimensional spatial region - http://purl.obolibrary.org/obo/BFO_0000026
+
+
+
+
+
+
+
one-dimensional temporal region - http://purl.obolibrary.org/obo/BFO_0000038
+
+
+
+
+
+
+
ontology module - http://purl.obolibrary.org/obo/IAO_8000000
+
+
+
+
+
+
+
ontology module subsetted by OWL profile - http://purl.obolibrary.org/obo/IAO_8000019
+
+
+
+
+
+
+
ontology module subsetted by expressivity - http://purl.obolibrary.org/obo/IAO_8000017
+
+
+
+
+
+
+
ontology term requester - http://purl.obolibrary.org/obo/IAO_0000234
+
+
+
+
+
+
+
optional part of NMR instrument - http://nmrML.org/nmrCV#NMR:1400001
+
+
+
+
+
+
+
+
+
+
organism - http://purl.obolibrary.org/obo/OBI_0100026
+
+
+
+
+ - organism has curation status ready for release
+- organism example of usage "fungus"@en
+- organism definition source "WEB: http://en.wikipedia.org/wiki/Organism"@en
+- organism example of usage "plant"@en
+- organism example of usage "virus"@en
+- organism definition "A material entity that is an individual living system, such as animal, plant, bacteria or virus, that is capable of replicating or reproducing, growth and maintenance in the right environment. An organism may be unicellular or made up, like humans, of many billions of cells divided into specialized tissues and organs."@en
+- organism term editor "GROUP: OBI Biomaterial Branch"
+- organism editor note "10/21/09: This is a placeholder term, that should ideally be imported from the NCBI taxonomy, but the high level hierarchy there does not suit our needs (includes plasmids and 'other organisms')"
+- organism editor preferred term "organism"@en
+- organism editor note "13-02-2009:
+OBI doesn't take position as to when an organism starts or ends being an organism - e.g. sperm, foetus.
+This issue is outside the scope of OBI."
+- organism label "organism"@en
+- organism example of usage "animal"@en
+- Class: organism
+- organism SubClassOf material entity
+
+
+
+
organization - http://purl.obolibrary.org/obo/OBI_0000245
+
+
+
+
+ - organization label "organization"@en
+- organization term editor "PERSON: Susanna Sansone"
+- organization term editor "PERSON: Alan Ruttenberg"
+- organization example of usage "PMID: 16353909.AAPS J. 2005 Sep 22;7(2):E274-80. Review. The joint food and agriculture organization of the United Nations/World Health Organization Expert Committee on Food Additives and its role in the evaluation of the safety of veterinary drug residues in foods."@en
+- organization has curation status ready for release
+- organization term editor "PERSON: Philippe Rocca-Serra"
+- organization editor preferred term "organization"@en
+- organization definition "An entity that can bear roles, has members, and has a set of organization rules. Members of organizations are either organizations themselves or individual people. Members can bear specific organization member roles that are determined in the organization rules. The organization rules also determine how decisions are made on behalf of the organization by the organization members."@en
+- organization editor note "BP: The definition summarizes long email discussions on the OBI developer, roles, biomaterial and denrie branches. It leaves open if an organization is a material entity or a dependent continuant, as no consensus was reached on that. The current placement as material is therefore temporary, in order to move forward with development. Here is the entire email summary, on which the definition is based:
+
+1) there are organization_member_roles (president, treasurer, branch
+editor), with individual persons as bearers
+
+2) there are organization_roles (employer, owner, vendor, patent holder)
+
+3) an organization has a charter / rules / bylaws, which specify what roles
+there are, how they should be realized, and how to modify the
+charter/rules/bylaws themselves.
+
+It is debatable what the organization itself is (some kind of dependent
+continuant or an aggregate of people). This also determines who/what the
+bearer of organization_roles' are. My personal favorite is still to define
+organization as a kind of 'legal entity', but thinking it through leads to
+all kinds of questions that are clearly outside the scope of OBI.
+
+Interestingly enough, it does not seem to matter much where we place
+organization itself, as long as we can subclass it (University, Corporation,
+Government Agency, Hospital), instantiate it (Affymetrix, NCBI, NIH, ISO,
+W3C, University of Oklahoma), and have it play roles.
+
+This leads to my proposal: We define organization through the statements 1 -
+3 above, but without an 'is a' statement for now. We can leave it in its
+current place in the is_a hierarchy (material entity) or move it up to
+'continuant'. We leave further clarifications to BFO, and close this issue
+for now."@en
+- organization term editor "PERSON: Bjoern Peters"
+- organization definition source "GROUP: OBI"
+- Class: organization
+- organization SubClassOf material entity
+
+
+
+
organizational term - http://purl.obolibrary.org/obo/IAO_0000121
+
+
+
+
+
+
+
osmium tetroxide - http://purl.obolibrary.org/obo/CHEBI_88215
+
+
+
+
+
+
+
out of scope - http://purl.obolibrary.org/obo/OMO_0001000
+
+
+
+
+
+
+
overlaps - http://purl.obolibrary.org/obo/RO_0002131
+
+
+
+
+
+
+
oxolane-d8 - http://purl.obolibrary.org/obo/CHEBI_193047
+
+
+
+
+ - oxolane-d8 has_exact_synonym "2,2,3,3,4,4,5,5-octadeuteriooxolane"
+- oxolane-d8 has_obo_namespace "chebi_ontology"
+- oxolane-d8 charge "0"
+- oxolane-d8 inchi "InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2/i1D2,2D2,3D2,4D2"
+- oxolane-d8 database_cross_reference "CAS:1693-74-9"
+- oxolane-d8 database_cross_reference "Wikipedia:https://en.wikipedia.org/wiki/Deuterated_THF"
+- oxolane-d8 smiles "O1C(C(C(C1([H])[H])([H])[H])([H])[H])([H])[H]"
+- oxolane-d8 formula "C4D8O"
+- oxolane-d8 inchikey "WYURNTSHIVDZCO-SVYQBANQSA-N"
+- oxolane-d8 has related synonym "tetrahydrofuran-d8"
+- oxolane-d8 label "oxolane-d8"
+- oxolane-d8 monoisotopicmass "80.10773"
+- oxolane-d8 id "CHEBI:193047"
+- oxolane-d8 mass "80.156"
+- oxolane-d8 inSubset _STAR
+- oxolane-d8 has related synonym "deuterated THF"
+- oxolane-d8 has related synonym "THF-d8"
+- Class: oxolane-d8
+- oxolane-d8 SubClassOf polyatomic entity
+- oxolane-d8 SubClassOf main group molecular entity
+- oxolane-d8 SubClassOf NMR solvent
+- oxolane-d8 SubClassOf deuterated compound
+
+
+
+
oxygen-17 atom - http://purl.obolibrary.org/obo/CHEBI_33819
+
+
+
+
+
+
+
part of - http://purl.obolibrary.org/obo/BFO_0000050
+
+
+
+
+
+
+
participates in - http://purl.obolibrary.org/obo/RO_0000056
+
+
+
+
+
+
+
pending final vetting - http://purl.obolibrary.org/obo/IAO_0000125
+
+
+
+
+
+
+
pentacarbonyliron - http://purl.obolibrary.org/obo/CHEBI_30251
+
+
+
+
+
+
+
peptide - http://nmrML.org/nmrCV#NMR:1000860
+
+
+
+
+
+
+
+
+
+
phosphoric acid - http://purl.obolibrary.org/obo/CHEBI_26078
+
+
+
+
+
+
+
phosphoric acid - http://nmrML.org/nmrCV#NMR:1000059
+
+
+
+
+
+
+
+
+
+
phosphorus - http://nmrML.org/nmrCV#NMR:1000060
+
+
+
+
+
+
+
+
+
+
phosphorus-31 atom - http://purl.obolibrary.org/obo/CHEBI_37971
+
+
+
+
+
+
+
placeholder removed - http://purl.obolibrary.org/obo/IAO_0000226
+
+
+
+
+
+
+
plan specification - http://purl.obolibrary.org/obo/IAO_0000104
+
+
+
+
+
+
+
planned process - http://purl.obolibrary.org/obo/OBI_0000011
+
+
+
+
+
+
+
plural form - http://purl.obolibrary.org/obo/OMO_0003004
+
+
+
+
+
+
+
polyatomic entity - http://purl.obolibrary.org/obo/CHEBI_36357
+
+
+
+
+
+
+
potassium chloride - http://purl.obolibrary.org/obo/CHEBI_32588
+
+
+
+
+
+
+
potassium chromate - http://purl.obolibrary.org/obo/CHEBI_75249
+
+
+
+
+
+
+
potassium fluoride - http://purl.obolibrary.org/obo/CHEBI_66872
+
+
+
+
+
+
+
potassium hexachloroniobate(1-) - http://purl.obolibrary.org/obo/CHEBI_231541
+
+
+
+
+
+
+
potassium iodide - http://purl.obolibrary.org/obo/CHEBI_8346
+
+
+
+
+
+
+
potassium-39 atom - http://purl.obolibrary.org/obo/CHEBI_52632
+
+
+
+
+
+
+
preferredNamespacePrefix - http://purl.org/vocab/vann/preferredNamespacePrefix
+
+
+
+
+
+
+
previous name - http://purl.obolibrary.org/obo/OMO_0003008
+
+
+
+
+
+
+
process - http://purl.obolibrary.org/obo/BFO_0000015
+
+
+
+
+
+
+
+ - process comment "An occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t."@en
+- process example of usage "a process of meiosis"@en
+- process example of usage "the course of a disease"@en
+- process has associated axiom(fol) "(iff (Process a) (and (Occurrent a) (exists (b) (properTemporalPartOf b a)) (exists (c t) (and (MaterialEntity c) (specificallyDependsOnAt a c t))))) // axiom label in BFO2 CLIF: [083-003] "
+- process editor note "BFO 2 Reference: The realm of occurrents is less pervasively marked by the presence of natural units than is the case in the realm of independent continuants. Thus there is here no counterpart of ‘object’. In BFO 1.0 ‘process’ served as such a counterpart. In BFO 2.0 ‘process’ is, rather, the occurrent counterpart of ‘material entity’. Those natural – as contrasted with engineered, which here means: deliberately executed – units which do exist in the realm of occurrents are typically either parasitic on the existence of natural units on the continuant side, or they are fiat in nature. Thus we can count lives; we can count football games; we can count chemical reactions performed in experiments or in chemical manufacturing. We cannot count the processes taking place, for instance, in an episode of insect mating behavior.Even where natural units are identifiable, for example cycles in a cyclical process such as the beating of a heart or an organism’s sleep/wake cycle, the processes in question form a sequence with no discontinuities (temporal gaps) of the sort that we find for instance where billiard balls or zebrafish or planets are separated by clear spatial gaps. Lives of organisms are process units, but they too unfold in a continuous series from other, prior processes such as fertilization, and they unfold in turn in continuous series of post-life processes such as post-mortem decay. Clear examples of boundaries of processes are almost always of the fiat sort (midnight, a time of death as declared in an operating theater or on a death certificate, the initiation of a state of war)"@en
+- process example of usage "the flight of a bird"@en
+- process example of usage "your process of aging."@en
+- process isDefinedBy bfo.owl
+- process example of usage "a process of sleeping"@en
+- process example of usage "the life of an organism"@en
+- process label "process"@en
+- process BFO CLIF specification label "Process"
+- process example of usage "a process of cell-division, \ a beating of the heart"@en
+- process definition "p is a process = Def. p is an occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t. (axiom label in BFO2 Reference: [083-003])"@en
+- process BFO OWL specification label "process"
+- process SubClassOf occurrent
+
+
+
+
process boundary - http://purl.obolibrary.org/obo/BFO_0000035
+
+
+
+
+
+
+
process profile - http://purl.obolibrary.org/obo/BFO_0000144
+
+
+
+
+ - process profile definition "b is a process_profile =Def. there is some process c such that b process_profile_of c (axiom label in BFO2 Reference: [093-002])"@en
+- process profile BFO CLIF specification label "ProcessProfile"
+- process profile BFO OWL specification label "process-profile"
+- process profile elucidation "b process_profile_of c holds when b proper_occurrent_part_of c& there is some proper_occurrent_part d of c which has no parts in common with b & is mutually dependent on b& is such that b, c and d occupy the same temporal region (axiom label in BFO2 Reference: [094-005])"@en
+- process profile has associated axiom(fol) "(forall (x y) (if (processProfileOf x y) (and (properContinuantPartOf x y) (exists (z t) (and (properOccurrentPartOf z y) (TemporalRegion t) (occupiesSpatioTemporalRegion x t) (occupiesSpatioTemporalRegion y t) (occupiesSpatioTemporalRegion z t) (not (exists (w) (and (occurrentPartOf w x) (occurrentPartOf w z))))))))) // axiom label in BFO2 CLIF: [094-005] "
+- process profile example of usage "One important sub-family of rate process profiles is illustrated by the beat or frequency profiles of cyclical processes, illustrated by the 60 beats per minute beating process of John’s heart, or the 120 beats per minute drumming process involved in one of John’s performances in a rock band, and so on. Each such process includes what we shall call a beat process profile instance as part, a subtype of rate process profile in which the salient ratio is not distance covered but rather number of beat cycles per unit of time. Each beat process profile instance instantiates the determinable universal beat process profile. But it also instantiates multiple more specialized universals at lower levels of generality, selected from rate process profilebeat process profileregular beat process profile3 bpm beat process profile4 bpm beat process profileirregular beat process profileincreasing beat process profileand so on.In the case of a regular beat process profile, a rate can be assigned in the simplest possible fashion by dividing the number of cycles by the length of the temporal region occupied by the beating process profile as a whole. Irregular process profiles of this sort, for example as identified in the clinic, or in the readings on an aircraft instrument panel, are often of diagnostic significance."@en
+- process profile label "process profile"@en
+- process profile isDefinedBy bfo.owl
+- process profile example of usage "The simplest type of process profiles are what we shall call ‘quality process profiles’, which are the process profiles which serve as the foci of the sort of selective abstraction that is involved when measurements are made of changes in single qualities, as illustrated, for example, by process profiles of mass, temperature, aortic pressure, and so on."@en
+- process profile has associated axiom(fol) "(iff (ProcessProfile a) (exists (b) (and (Process b) (processProfileOf a b)))) // axiom label in BFO2 CLIF: [093-002] "
+- process profile example of usage "On a somewhat higher level of complexity are what we shall call rate process profiles, which are the targets of selective abstraction focused not on determinate quality magnitudes plotted over time, but rather on certain ratios between these magnitudes and elapsed times. A speed process profile, for example, is represented by a graph plotting against time the ratio of distance covered per unit of time. Since rates may change, and since such changes, too, may have rates of change, we have to deal here with a hierarchy of process profile universals at successive levels"@en
+- Class: process profile
+- process profile DisjointWith history
+- process profile SubClassOf process
+
+
+
+
processed material - http://purl.obolibrary.org/obo/OBI_0000047
+
+
+
+
+
+
+
protein - http://nmrML.org/nmrCV#NMR:1000882
+
+
+
+
+
+
+
+
+
+
protium atom - http://purl.obolibrary.org/obo/CHEBI_29236
+
+
+
+
+
+
+
publisher - http://purl.org/dc/elements/1.1/publisher
+
+
+
+
+
+
+
pyridine - http://purl.obolibrary.org/obo/CHEBI_16227
+
+
+
+
+
+
+
pyridine - http://nmrML.org/nmrCV#NMR:1000041
+
+
+
+
+
+
+
+
+
+
pyridine-d5 - http://purl.obolibrary.org/obo/CHEBI_193046
+
+
+
+
+
+
+
quadrature detection - http://nmrML.org/nmrCV#NMR:1000008
+
+
+
+ - quadrature detection comment "One of the problems that should be apparent after observing the spectrum and the FID is that it is not possible
+to determine if the frequency is positive or negative. The instrument uses a spectrometer
+frequency and all signal frequencies are measured relative to the spectrometer frequency. If a molecule
+produces two signals, one at 300,000,001 Hz and another at 299,999,999 Hz, and the spectrometer frequency
+is 300,000,000 Hz, the first signal is at +1 Hz and the second is at -1 Hz. Electronically the lower frequency
+signals are very easy frequency to detect, transmit, amplify and sample.
+The complication with this rotating frame of reference is that a single detector can not distinguish positive and
+negative frequencies. This problem is why quadrature detection is important. Quadrature detection uses two detector channels
+separated by 90 degrees. These are referred to as the real channel and the imaginary channel. Using these
+two channels, it is possible to distinguish positive and negative frequencies. This section shows how the
+quadrature signal is processed to obtain an NMR spectrum.
+The Fourier transform produces a complex number with a real and an imaginary component. The Re function
+extracts the real spectrum and the Im function extracts the imaginary spectrum from the complex number."
+
+
+
+
+
+ - quadrature detection comment "One of the problems that should be apparent after observing the spectrum and the FID is that it is not possible
+to determine if the frequency is positive or negative. The instrument uses a spectrometer
+frequency and all signal frequencies are measured relative to the spectrometer frequency. If a molecule
+produces two signals, one at 300,000,001 Hz and another at 299,999,999 Hz, and the spectrometer frequency
+is 300,000,000 Hz, the first signal is at +1 Hz and the second is at -1 Hz. Electronically the lower frequency
+signals are very easy frequency to detect, transmit, amplify and sample.
+The complication with this rotating frame of reference is that a single detector can not distinguish positive and
+negative frequencies. This problem is why quadrature detection is important. Quadrature detection uses two detector channels
+separated by 90 degrees. These are referred to as the real channel and the imaginary channel. Using these
+two channels, it is possible to distinguish positive and negative frequencies. This section shows how the
+quadrature signal is processed to obtain an NMR spectrum.
+The Fourier transform produces a complex number with a real and an imaginary component. The Re function
+extracts the real spectrum and the Im function extracts the imaginary spectrum from the complex number."
+
+
+
+
quality - http://purl.obolibrary.org/obo/BFO_0000019
+
+
+
+
+
+
+
+
+
+
quality of - http://purl.obolibrary.org/obo/RO_0000080
+
+
+
+
+
+
+
ready for release - http://purl.obolibrary.org/obo/IAO_0000122
+
+
+
+
+
+
+
realizable entity - http://purl.obolibrary.org/obo/BFO_0000017
+
+
+
+
+
+
+
+
+
+
realized in - http://purl.obolibrary.org/obo/BFO_0000054
+
+
+
+
+
+
+
realizes - http://purl.obolibrary.org/obo/BFO_0000055
+
+
+
+
+ - realizes example of usage "this investigation realizes this investigator role"@en
+- realizes comment "Paraphrase of elucidation: a relation between a process and a realizable entity, where there is some material entity that is bearer of the realizable entity and participates in the process, and the realizable entity comes to be realized in the course of the process"
+- realizes editor preferred term "realizes"@en
+- realizes example of usage "this shattering realizes this fragility"@en
+- realizes definition "Paraphrase of elucidation: a relation between a process and a realizable entity, where there is some material entity that is bearer of the realizable entity and participates in the process, and the realizable entity comes to be realized in the course of the process"@en
+- realizes label "realizes"@en
+- realizes elucidation "to say that b realizes c at t is to assert that there is some material entity d & b is a process which has participant d at t & c is a disposition or role of which d is bearer_of at t& the type instantiated by b is correlated with the type instantiated by c. (axiom label in BFO2 Reference: [059-003])"@en
+- realizes example of usage "this disease course realizes this disease"@en
+- realizes isDefinedBy iao.owl
+- ObjectProperty: realizes
+- realizes Domain process
+- realizes Range realizable entity
+
+
+
+
reasoned ontology module - http://purl.obolibrary.org/obo/IAO_8000013
+
+
+
+
+
+
+
references - http://purl.org/dc/terms/references
+
+
+
+
+
+
+
relation - http://purl.org/dc/elements/1.1/relation
+
+
+
+
+
+
+
relational quality - http://purl.obolibrary.org/obo/BFO_0000145
+
+
+
+
+
+
+
requires discussion - http://purl.obolibrary.org/obo/IAO_0000428
+
+
+
+
+
+
+
rhodium acetylacetonate - http://purl.obolibrary.org/obo/CHEBI_229457
+
+
+
+
+
+
+
rights - http://purl.org/dc/elements/1.1/rights
+
+
+
+
+ - AnnotationProperty: rights
+
+
+
+
ro-eco - http://purl.obolibrary.org/obo/ro/subsets#ro-eco
+
+
+
+
+
+
+
role - http://purl.obolibrary.org/obo/BFO_0000023
+
+
+
+
+ - role example of usage "the role of a stone in marking a property boundary"@en
+- role example of usage "John’s role of husband to Mary is dependent on Mary’s role of wife to John, and both are dependent on the object aggregate comprising John and Mary as member parts joined together through the relational quality of being married."@en
+- role example of usage "the priest role"@en
+- role elucidation "b is a role means: b is a realizable entity & b exists because there is some single bearer that is in some special physical, social, or institutional set of circumstances in which this bearer does not have to be& b is not such that, if it ceases to exist, then the physical make-up of the bearer is thereby changed. (axiom label in BFO2 Reference: [061-001])"@en
+- role definition "A realizable entity the manifestation of which brings about some result or end that is not essential to a continuant in virtue of the kind of thing that it is but that can be served or participated in by that kind of continuant in some kinds of natural, social or institutional contexts."@en
+- role label "role"@en
+- role BFO CLIF specification label "Role"
+- role BFO OWL specification label "role"
+- role example of usage "the student role"@en
+- role example of usage "the role of a boundary to demarcate two neighboring administrative territories"@en
+- role example of usage "the role of subject in a clinical trial"@en
+- role example of usage "the role of a building in serving as a military target"@en
+- role has associated axiom(fol) "(forall (x) (if (Role x) (RealizableEntity x))) // axiom label in BFO2 CLIF: [061-001] "
+- role editor note "BFO 2 Reference: One major family of examples of non-rigid universals involves roles, and ontologies developed for corresponding administrative purposes may consist entirely of representatives of entities of this sort. Thus ‘professor’, defined as follows,b instance_of professor at t =Def. there is some c, c instance_of professor role & c inheres_in b at t.denotes a non-rigid universal and so also do ‘nurse’, ‘student’, ‘colonel’, ‘taxpayer’, and so forth. (These terms are all, in the jargon of philosophy, phase sortals.) By using role terms in definitions, we can create a BFO conformant treatment of such entities drawing on the fact that, while an instance of professor may be simultaneously an instance of trade union member, no instance of the type professor role is also (at any time) an instance of the type trade union member role (any more than any instance of the type color is at any time an instance of the type length).If an ontology of employment positions should be defined in terms of roles following the above pattern, this enables the ontology to do justice to the fact that individuals instantiate the corresponding universals – professor, sergeant, nurse – only during certain phases in their lives."@en
+- role isDefinedBy bfo.owl
+- Class: role
+- role SubClassOf realizable entity
+
+
+
+
role of - http://purl.obolibrary.org/obo/RO_0000081
+
+
+
+
+ - role of label "role of"@en
+- role of alternative term "role_of"@en
+- role of alternative term "is role of"@en
+- role of editor note "A role inheres in its bearer at all times for which the role exists, however the role need not be realized at all the times that the role exists."@en
+- role of definition "a relation between a role and an independent continuant (the bearer), in which the role specifically depends on the bearer for its existence"@en
+- role of comment "This relation is modeled after the BFO relation of the same name which was in BFO2, but is used in a more restricted sense - specifically, we model this relation as functional (inherited from characteristic-of). Note that this relation is now removed from BFO2020."
+- role of example of usage "this investigator role is a role of this person"@en
+- ObjectProperty: role of
+- role of InverseOf has role
+- role of SubPropertyOf: characteristic of
+
+
+
+
rubidium chloride - http://purl.obolibrary.org/obo/CHEBI_78672
+
+
+
+
+
+
+
rubidium-85 atom - http://purl.obolibrary.org/obo/CHEBI_176572
+
+
+
+
+
+
+
rubidium-87 atom - http://purl.obolibrary.org/obo/CHEBI_52459
+
+
+
+
+
+
+
scandium nitrate - http://purl.obolibrary.org/obo/CHEBI_231498
+
+
+
+
+
+
+
scandium-45 atom - http://purl.obolibrary.org/obo/CHEBI_52635
+
+
+
+
+
+
+
scheduled for obsoletion on or after - http://purl.obolibrary.org/obo/IAO_0006012
+
+
+
+
+
+
+
seeAlso - http://www.w3.org/2000/01/rdf-schema#seeAlso
+
+
+
+
+
+
+
selenium-77 atom - http://purl.obolibrary.org/obo/CHEBI_52457
+
+
+
+
+
+
+
setting datum - http://purl.obolibrary.org/obo/IAO_0000140
+
+
+
+
+
+
+
shorthand - http://www.geneontology.org/formats/oboInOwl#shorthand
+
+
+
+
+
+
+
silicon-29 atom - http://purl.obolibrary.org/obo/CHEBI_37974
+
+
+
+
+
+
+
silver(1+) nitrate - http://purl.obolibrary.org/obo/CHEBI_32130
+
+
+
+
+
+
+
single layer subset ontology module - http://purl.obolibrary.org/obo/IAO_8000009
+
+
+
+
+
+
+
site - http://purl.obolibrary.org/obo/BFO_0000029
+
+
+
+
+
+
+
smiles - http://purl.obolibrary.org/obo/chebi/smiles
+
+
+
+
+ - AnnotationProperty: smiles
+
+
+
+
sodium 3-(trimethylsilyl)propionate - http://purl.obolibrary.org/obo/CHEBI_85363
+
+
+
+
+
+
+
sodium acetate - http://purl.obolibrary.org/obo/CHEBI_32954
+
+
+
+
+
+
+
sodium acetate - http://nmrML.org/nmrCV#NMR:1000028
+
+
+
+
+
+
+
+
+
+
sodium bromide - http://purl.obolibrary.org/obo/CHEBI_63004
+
+
+
+
+
+
+
sodium chloride - http://purl.obolibrary.org/obo/CHEBI_26710
+
+
+
+
+
+
+
sodium hexachloroplatinate - http://purl.obolibrary.org/obo/CHEBI_59606
+
+
+
+
+
+
+
sodium molybdate (anhydrous) - http://purl.obolibrary.org/obo/CHEBI_75215
+
+
+
+
+
+
+
sodium nitrate - http://nmrML.org/nmrCV#NMR:1000042
+
+
+
+
+
+
+
+
+
+
sodium nitrate - http://purl.obolibrary.org/obo/CHEBI_63005
+
+
+
+
+
+
+
sodium trimethylsilyl-propionate - http://nmrML.org/nmrCV#NMR:1000077
+
+
+
+
+
+
+
+
+
+
sodium tungstate - http://purl.obolibrary.org/obo/CHEBI_63940
+
+
+
+
+
+
+
sodium-23 atom - http://purl.obolibrary.org/obo/CHEBI_52634
+
+
+
+
+
+
+
solid phase extraction NMR - http://nmrML.org/nmrCV#NMR:1400278
+
+
+
+
+
+
+
+
+
+
source - http://www.geneontology.org/formats/oboInOwl#source
+
+
+
+
+ - AnnotationProperty: source
+
+
+
+
source - http://purl.org/dc/terms/source
+
+
+
+
+ - AnnotationProperty: source
+
+
+
+
spatial region - http://purl.obolibrary.org/obo/BFO_0000006
+
+
+
+
+
+
+
spatiotemporal region - http://purl.obolibrary.org/obo/BFO_0000011
+
+
+
+
+
+
+
species subset ontology module - http://purl.obolibrary.org/obo/IAO_8000012
+
+
+
+
+
+
+
specifically dependent continuant - http://purl.obolibrary.org/obo/BFO_0000020
+
+
+
+
+
+
+
strontium dichloride - http://purl.obolibrary.org/obo/CHEBI_36383
+
+
+
+
+
+
+
subject - http://purl.org/dc/elements/1.1/subject
+
+
+
+
+
+
+
subset ontology module - http://purl.obolibrary.org/obo/IAO_8000006
+
+
+
+
+
+
+
sulfur hexafluoride - http://purl.obolibrary.org/obo/CHEBI_30496
+
+
+
+
+
+
+
sulfur-33 atom - http://purl.obolibrary.org/obo/CHEBI_37980
+
+
+
+
+
+
+
summation projection - http://nmrML.org/nmrCV#NMR:1400077
+
+
+
+ - summation projection comment "def: .A projection method that sums the intensities of a pre-processed 2D J-resolved NMR spectrum to obtain a projected spectrum.
+ altdef: The adding of spectra together to produce a composite avergaed spectrum."^^string
+
+
+
+
+
+ - summation projection comment "def: .A projection method that sums the intensities of a pre-processed 2D J-resolved NMR spectrum to obtain a projected spectrum.
+ altdef: The adding of spectra together to produce a composite avergaed spectrum."
+
+
+
+
taxonomic bridge ontology module - http://purl.obolibrary.org/obo/IAO_8000016
+
+
+
+
+
+
+
technetium-99 - http://purl.obolibrary.org/obo/CHEBI_33371
+
+
+
+
+
+
+
tecmag - http://nmrML.org/nmrCV#NMR:1400260
+
+
+
+
+
+
+
+
+
+
tecmag NMR instrument - http://nmrML.org/nmrCV#NMR:1400250
+
+
+
+
+
+
+
tecmag console - http://nmrML.org/nmrCV#NMR:1400246
+
+
+
+
+
+
+
tellurium-125 atom - http://purl.obolibrary.org/obo/CHEBI_52452
+
+
+
+
+
+
+
template generated ontology module - http://purl.obolibrary.org/obo/IAO_8000015
+
+
+
+
+
+
+
temporal region - http://purl.obolibrary.org/obo/BFO_0000008
+
+
+
+
+
+
+
term editor - http://purl.obolibrary.org/obo/IAO_0000117
+
+
+
+
+
+
+
term imported - http://purl.obolibrary.org/obo/IAO_0000228
+
+
+
+
+
+
+
term replaced by - http://purl.obolibrary.org/obo/IAO_0100001
+
+
+
+
+
+
+
term split - http://purl.obolibrary.org/obo/IAO_0000229
+
+
+
+
+
+
+
term tracker item - http://purl.obolibrary.org/obo/IAO_0000233
+
+
+
+
+
+
+
terms merged - http://purl.obolibrary.org/obo/IAO_0000227
+
+
+
+
+
+
+
test tube - http://purl.obolibrary.org/obo/OBI_0000836
+
+
+
+
+
+
+
tetracarbonylnickel - http://purl.obolibrary.org/obo/CHEBI_30372
+
+
+
+
+
+
+
tetramethylammonium bromide - http://nmrML.org/nmrCV#NMR:1000035
+
+
+
+
+
+
+
+
+
+
tetramethylammonium bromide - http://purl.obolibrary.org/obo/CHEBI_55317
+
+
+
+
+
+
+
tetramethylgermane - http://purl.obolibrary.org/obo/CHEBI_231506
+
+
+
+
+
+
+
tetramethyllead - http://purl.obolibrary.org/obo/CHEBI_30183
+
+
+
+
+
+
+
tetramethylsilane - http://nmrML.org/nmrCV#NMR:1000029
+
+
+
+
+
+
+
+
+
+
tetramethylsilane - http://purl.obolibrary.org/obo/CHEBI_85361
+
+
+
+
+
+
+
tetramethylsilane-d12 - http://purl.obolibrary.org/obo/CHEBI_231529
+
+
+
+
+
+
+
tetramethyltin - http://purl.obolibrary.org/obo/CHEBI_30420
+
+
+
+
+
+
+
thallium(III) nitrate - http://purl.obolibrary.org/obo/CHEBI_229458
+
+
+
+
+
+
+
three-dimensional spatial region - http://purl.obolibrary.org/obo/BFO_0000028
+
+
+
+
+
+
+
tin-115 atom - http://purl.obolibrary.org/obo/CHEBI_52235
+
+
+
+
+
+
+
tin-117 atom - http://purl.obolibrary.org/obo/CHEBI_52234
+
+
+
+
+
+
+
tin-119 atom - http://purl.obolibrary.org/obo/CHEBI_52230
+
+
+
+
+
+
+
titanium tetrachloride - http://purl.obolibrary.org/obo/CHEBI_231499
+
+
+
+
+
+
+
title - http://purl.org/dc/terms/title
+
+
+
+
+
+
+
title - http://purl.org/dc/elements/1.1/title
+
+
+
+
+ - AnnotationProperty: title
+
+
+
+
to be replaced with external ontology term - http://purl.obolibrary.org/obo/IAO_0000423
+
+
+
+
+
+
+
toluene-d8 - http://purl.obolibrary.org/obo/CHEBI_193048
+
+
+
+
+ - toluene-d8 has related synonym "perdeuterated toluene"
+- toluene-d8 charge "0"
+- toluene-d8 database_cross_reference "CAS:2037-26-5"
+- toluene-d8 has related synonym "perdeuteriotoluene"
+- toluene-d8 inSubset _STAR
+- toluene-d8 inchi "InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i1D3,2D,3D,4D,5D,6D"
+- toluene-d8 id "CHEBI:193048"
+- toluene-d8 inchikey "YXFVVABEGXRONW-JGUCLWPXSA-N"
+- toluene-d8 has related synonym "octadeuterotoluene"
+- toluene-d8 mass "100.190"
+- toluene-d8 smiles "C1(=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])C([2H])([2H])[2H]"
+- toluene-d8 monoisotopicmass "100.11281"
+- toluene-d8 label "toluene-d8"
+- toluene-d8 has_obo_namespace "chebi_ontology"
+- toluene-d8 has_exact_synonym "1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene"
+- toluene-d8 formula "C7D8"
+- Class: toluene-d8
+- toluene-d8 SubClassOf main group molecular entity
+- toluene-d8 SubClassOf NMR solvent
+- toluene-d8 SubClassOf polyatomic entity
+- toluene-d8 SubClassOf deuterated compound
+
+
+
+
transition element molecular entity - http://purl.obolibrary.org/obo/CHEBI_33497
+
+
+
+
+
+
+
triangle window function - http://nmrML.org/nmrCV#NMR:1000309
+
+
+
+ - triangle window function comment "Functional form:
+ 0:loc linear increase/decrease from lHi to 1.0
+ loc: linear increase/decrease from 1.0 to rHi
+
+ Parameters:
+ * data Array of spectral data.
+ * loc Location of apex, "auto" sets to middle.
+ * lHi Left side starting height.
+ * rHi Right side starting height.
+ * inv Set True for inverse apodization."
+
+
+
+
+
+ - triangle window function comment "Functional form:
+ 0:loc linear increase/decrease from lHi to 1.0
+ loc: linear increase/decrease from 1.0 to rHi
+
+ Parameters:
+ * data Array of spectral data.
+ * loc Location of apex, "auto" sets to middle.
+ * lHi Left side starting height.
+ * rHi Right side starting height.
+ * inv Set True for inverse apodization."
+
+
+
+
trichlorofluoromethane - http://purl.obolibrary.org/obo/CHEBI_48236
+
+
+
+
+
+
+
trifluoroacetic acid - http://purl.obolibrary.org/obo/CHEBI_45892
+
+
+
+
+
+
+
trifluoroacetic acid-d1 - http://purl.obolibrary.org/obo/CHEBI_193050
+
+
+
+
+
+
+
trimethyl phosphate - http://nmrML.org/nmrCV#NMR:1000061
+
+
+
+
+
+
+
+
+
+
trimethyl phosphate - http://purl.obolibrary.org/obo/CHEBI_46324
+
+
+
+
+
+
+
triphenylphosphane oxide - http://purl.obolibrary.org/obo/CHEBI_36601
+
+
+
+
+
+
+
triphenylphosphine - http://nmrML.org/nmrCV#NMR:1000062
+
+
+
+
+
+
+
+
+
+
triphenylphosphine - http://purl.obolibrary.org/obo/CHEBI_183318
+
+
+
+
+
+
+
triphenylphosphine oxide - http://nmrML.org/nmrCV#NMR:1000063
+
+
+
+
+
+
+
+
+
+
tritium atom - http://purl.obolibrary.org/obo/CHEBI_29238
+
+
+
+
+
+
+
tungsten-183 - http://purl.obolibrary.org/obo/CHEBI_52462
+
+
+
+
+
+
+
two-dimensional continuant fiat boundary - http://purl.obolibrary.org/obo/BFO_0000146
+
+
+
+
+
+
+
two-dimensional spatial region - http://purl.obolibrary.org/obo/BFO_0000009
+
+
+
+
+
+
+
type - http://purl.org/dc/elements/1.1/type
+
+
+
+
+ - AnnotationProperty: type
+
+
+
+
uncurated - http://purl.obolibrary.org/obo/IAO_0000124
+
+
+
+
+
+
+
universal - http://purl.obolibrary.org/obo/IAO_0000410
+
+
+
+
+
+
+
valid_for_go_annotation_extension - http://purl.obolibrary.org/obo/valid_for_go_annotation_extension
+
+
+
+
+
+
+
valid_for_go_gp2term - http://purl.obolibrary.org/obo/valid_for_go_gp2term
+
+
+
+
+
+
+
valid_for_go_ontology - http://purl.obolibrary.org/obo/valid_for_go_ontology
+
+
+
+
+
+
+
valid_for_gocam - http://purl.obolibrary.org/obo/valid_for_gocam
+
+
+
+
+
+
+
vial - http://purl.obolibrary.org/obo/OBI_0000522
+
+
+
+
+
+
+
x-axis unit - http://nmrML.org/nmrCV#NMR:1400091
+
+
+
+ - x-axis unit comment "def: The units of measure for the x-axis of a (1D or 2D) FID, (1D or 2D) pre-processed spectrum, 2D projected spectrum, and (1D or 2D) post-processed spectrum.
+ altdef: The units used to represent either time domain (for a FID) or the frequency domain (for a spectrum)."^^string
+
+
+
+
+
+ - x-axis unit comment "def: The units of measure for the x-axis of a (1D or 2D) FID, (1D or 2D) pre-processed spectrum, 2D projected spectrum, and (1D or 2D) post-processed spectrum.
+ altdef: The units used to represent either time domain (for a FID) or the frequency domain (for a spectrum)."
+
+
+
+
xenon oxytetrafluoride - http://purl.obolibrary.org/obo/CHEBI_229456
+
+
+
+
+
+
+
xenon-129 atom - http://purl.obolibrary.org/obo/CHEBI_52453
+
+
+
+
+
+
+
yttrium nitrate - http://purl.obolibrary.org/obo/CHEBI_229454
+
+
+
+
+
+
+
yttrium-89 atom - http://purl.obolibrary.org/obo/CHEBI_52622
+
+
+
+
+
+
+
zero order phase correction - http://nmrML.org/nmrCV#NMR:1400079
+
+
+
+ - zero order phase correction comment "def: A parameter used to mix real and imaginary part of an NMR spectrum that the real part of the spectrum is in pure absorption mode.
+ altdef: The number of degrees that a central peak must be moved in order to achieve an absorptive mode line width."^^string
+
+
+
+
+
+ - zero order phase correction comment "def: A parameter used to mix real and imaginary part of an NMR spectrum that the real part of the spectrum is in pure absorption mode.
+ altdef: The number of degrees that a central peak must be moved in order to achieve an absorptive mode line width."
+
+
+
+
zero-dimensional continuant fiat boundary - http://purl.obolibrary.org/obo/BFO_0000147
+
+
+
+
+ - zero-dimensional continuant fiat boundary elucidation "a zero-dimensional continuant fiat boundary is a fiat point whose location is defined in relation to some material entity. (axiom label in BFO2 Reference: [031-001])"@en
+- zero-dimensional continuant fiat boundary editor note "zero dimension continuant fiat boundaries are not spatial points. Considering the example 'the quadripoint where the boundaries of Colorado, Utah, New Mexico, and Arizona meet' : There are many frames in which that point is zooming through many points in space. Whereas, no matter what the frame, the quadripoint is always in the same relation to the boundaries of Colorado, Utah, New Mexico, and Arizona."@en
+- zero-dimensional continuant fiat boundary label "zero-dimensional continuant fiat boundary"@en
+- zero-dimensional continuant fiat boundary BFO CLIF specification label "ZeroDimensionalContinuantFiatBoundary"
+- zero-dimensional continuant fiat boundary has associated axiom(fol) "(iff (ZeroDimensionalContinuantFiatBoundary a) (and (ContinuantFiatBoundary a) (exists (b) (and (ZeroDimensionalSpatialRegion b) (forall (t) (locatedInAt a b t)))))) // axiom label in BFO2 CLIF: [031-001] "
+- zero-dimensional continuant fiat boundary example of usage "the quadripoint where the boundaries of Colorado, Utah, New Mexico, and Arizona meet"@en
+- zero-dimensional continuant fiat boundary isDefinedBy bfo.owl
+- zero-dimensional continuant fiat boundary BFO OWL specification label "0d-cf-boundary"
+- zero-dimensional continuant fiat boundary example of usage "the geographic North Pole"@en
+- zero-dimensional continuant fiat boundary example of usage "the point of origin of some spatial coordinate system."@en
+- Class: zero-dimensional continuant fiat boundary
+- zero-dimensional continuant fiat boundary SubClassOf continuant fiat boundary
+
+
+
+
zero-dimensional spatial region - http://purl.obolibrary.org/obo/BFO_0000018
+
+
+
+
+
+
+
zero-dimensional temporal region - http://purl.obolibrary.org/obo/BFO_0000148
+
+
+
+
+
+
+
zinc nitrate - http://purl.obolibrary.org/obo/CHEBI_231504
+
+
+
+
+
+